About 2-[6-[(5-bromothiophen-2-yl)methylideneamino]-1,3-benzodioxol-5-yl]-N,N-dimethylethanamine
2-[6-[(5-bromothiophen-2-yl)methylideneamino]-1,3-benzodioxol-5-yl]-N,N-dimethylethanamine (PubChem CID 13280008) has the molecular formula C16H17BrN2O2S
and a molecular weight of 381.30 g/mol. Its IUPAC name is 2-[6-[(5-bromothiophen-2-yl)methylideneamino]-1,3-benzodioxol-5-yl]-N,N-dimethylethanamine.
Molecular Properties
| Compound Name | 2-[6-[(5-bromothiophen-2-yl)methylideneamino]-1,3-benzodioxol-5-yl]-N,N-dimethylethanamine |
| PubChem CID | 13280008 |
| Molecular Formula | C16H17BrN2O2S |
| Molecular Weight | 381.30 g/mol |
| Exact Mass | 380.02 |
| IUPAC Name | 2-[6-[(5-bromothiophen-2-yl)methylideneamino]-1,3-benzodioxol-5-yl]-N,N-dimethylethanamine |
| SMILES | CN(C)CCc1cc2c(cc1/N=C/c1ccc(Br)s1)OCO2 |
| InChI | InChI=1S/C16H17BrN2O2S/c1-19(2)6-5-11-7-14-15(21-10-20-14)8-13(11)18-9-12-3-4-16(17)22-12/h3-4,7-9H,5-6,10H2,1-2H3/b18-9+ |
| InChIKey | MHOUDGZUBVTELY-GIJQJNRQSA-N |
| XLogP | 4.09 |
| TPSA | 34.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 381.30 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze 2-[6-[(5-bromothiophen-2-yl)methylideneamino]-1,3-benzodioxol-5-yl]-N,N-dimethylethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[6-[(5-bromothiophen-2-yl)methylideneamino]-1,3-benzodioxol-5-yl]-N,N-dimethylethanamine?
The IUPAC name of 2-[6-[(5-bromothiophen-2-yl)methylideneamino]-1,3-benzodioxol-5-yl]-N,N-dimethylethanamine (CID 13280008) is 2-[6-[(5-bromothiophen-2-yl)methylideneamino]-1,3-benzodioxol-5-yl]-N,N-dimethylethanamine.
What is the SMILES notation for 2-[6-[(5-bromothiophen-2-yl)methylideneamino]-1,3-benzodioxol-5-yl]-N,N-dimethylethanamine?
The canonical SMILES for 2-[6-[(5-bromothiophen-2-yl)methylideneamino]-1,3-benzodioxol-5-yl]-N,N-dimethylethanamine is CN(C)CCc1cc2c(cc1/N=C/c1ccc(Br)s1)OCO2.
What is the InChIKey of 2-[6-[(5-bromothiophen-2-yl)methylideneamino]-1,3-benzodioxol-5-yl]-N,N-dimethylethanamine?
The InChIKey is MHOUDGZUBVTELY-GIJQJNRQSA-N. The full InChI is InChI=1S/C16H17BrN2O2S/c1-19(2)6-5-11-7-14-15(21-10-20-14)8-13(11)18-9-12-3-4-16(17)22-12/h3-4,7-9H,5-6,10H2,1-2H3/b18-9+.
What are the key properties of 2-[6-[(5-bromothiophen-2-yl)methylideneamino]-1,3-benzodioxol-5-yl]-N,N-dimethylethanamine?
2-[6-[(5-bromothiophen-2-yl)methylideneamino]-1,3-benzodioxol-5-yl]-N,N-dimethylethanamine has a molecular weight of 381.30 g/mol, XLogP of 4.09, 5 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[6-[(5-bromothiophen-2-yl)methylideneamino]-1,3-benzodioxol-5-yl]-N,N-dimethylethanamine is sourced from PubChem (CID 13280008), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).