About [8-chloro-6-(2-chlorophenyl)-1-oxo-3,4-dihydro-2H-pyrrolo[3,4-d][2]benzazepin-3-yl] benzoate
[8-chloro-6-(2-chlorophenyl)-1-oxo-3,4-dihydro-2H-pyrrolo[3,4-d][2]benzazepin-3-yl] benzoate (PubChem CID 13280959) has the molecular formula C25H16Cl2N2O3
and a molecular weight of 463.32 g/mol. Its IUPAC name is [8-chloro-6-(2-chlorophenyl)-1-oxo-3,4-dihydro-2H-pyrrolo[3,4-d][2]benzazepin-3-yl] benzoate.
Molecular Properties
| Compound Name | [8-chloro-6-(2-chlorophenyl)-1-oxo-3,4-dihydro-2H-pyrrolo[3,4-d][2]benzazepin-3-yl] benzoate |
| PubChem CID | 13280959 |
| Molecular Formula | C25H16Cl2N2O3 |
| Molecular Weight | 463.32 g/mol |
| Exact Mass | 462.05 |
| IUPAC Name | [8-chloro-6-(2-chlorophenyl)-1-oxo-3,4-dihydro-2H-pyrrolo[3,4-d][2]benzazepin-3-yl] benzoate |
| SMILES | O=C1NC(OC(=O)c2ccccc2)C2=C1c1ccc(Cl)cc1C(c1ccccc1Cl)=NC2 |
| InChI | InChI=1S/C25H16Cl2N2O3/c26-15-10-11-16-18(12-15)22(17-8-4-5-9-20(17)27)28-13-19-21(16)23(30)29-24(19)32-25(31)14-6-2-1-3-7-14/h1-12,24H,13H2,(H,29,30) |
| InChIKey | APOQPVQGMQJWOJ-UHFFFAOYSA-N |
| XLogP | 4.91 |
| TPSA | 67.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 463.32 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze [8-chloro-6-(2-chlorophenyl)-1-oxo-3,4-dihydro-2H-pyrrolo[3,4-d][2]benzazepin-3-yl] benzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [8-chloro-6-(2-chlorophenyl)-1-oxo-3,4-dihydro-2H-pyrrolo[3,4-d][2]benzazepin-3-yl] benzoate?
The IUPAC name of [8-chloro-6-(2-chlorophenyl)-1-oxo-3,4-dihydro-2H-pyrrolo[3,4-d][2]benzazepin-3-yl] benzoate (CID 13280959) is [8-chloro-6-(2-chlorophenyl)-1-oxo-3,4-dihydro-2H-pyrrolo[3,4-d][2]benzazepin-3-yl] benzoate.
What is the SMILES notation for [8-chloro-6-(2-chlorophenyl)-1-oxo-3,4-dihydro-2H-pyrrolo[3,4-d][2]benzazepin-3-yl] benzoate?
The canonical SMILES for [8-chloro-6-(2-chlorophenyl)-1-oxo-3,4-dihydro-2H-pyrrolo[3,4-d][2]benzazepin-3-yl] benzoate is O=C1NC(OC(=O)c2ccccc2)C2=C1c1ccc(Cl)cc1C(c1ccccc1Cl)=NC2.
What is the InChIKey of [8-chloro-6-(2-chlorophenyl)-1-oxo-3,4-dihydro-2H-pyrrolo[3,4-d][2]benzazepin-3-yl] benzoate?
The InChIKey is APOQPVQGMQJWOJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C25H16Cl2N2O3/c26-15-10-11-16-18(12-15)22(17-8-4-5-9-20(17)27)28-13-19-21(16)23(30)29-24(19)32-25(31)14-6-2-1-3-7-14/h1-12,24H,13H2,(H,29,30).
What are the key properties of [8-chloro-6-(2-chlorophenyl)-1-oxo-3,4-dihydro-2H-pyrrolo[3,4-d][2]benzazepin-3-yl] benzoate?
[8-chloro-6-(2-chlorophenyl)-1-oxo-3,4-dihydro-2H-pyrrolo[3,4-d][2]benzazepin-3-yl] benzoate has a molecular weight of 463.32 g/mol, XLogP of 4.91, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [8-chloro-6-(2-chlorophenyl)-1-oxo-3,4-dihydro-2H-pyrrolo[3,4-d][2]benzazepin-3-yl] benzoate is sourced from PubChem (CID 13280959), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).