About ethyl 2-[[4-cyano-1-(2,3,4-trichlorophenyl)pyrazol-5-yl]amino]acetate
ethyl 2-[[4-cyano-1-(2,3,4-trichlorophenyl)pyrazol-5-yl]amino]acetate (PubChem CID 13281455) has the molecular formula C14H11Cl3N4O2
and a molecular weight of 373.63 g/mol. Its IUPAC name is ethyl 2-[[4-cyano-1-(2,3,4-trichlorophenyl)pyrazol-5-yl]amino]acetate.
Molecular Properties
| Compound Name | ethyl 2-[[4-cyano-1-(2,3,4-trichlorophenyl)pyrazol-5-yl]amino]acetate |
| PubChem CID | 13281455 |
| Molecular Formula | C14H11Cl3N4O2 |
| Molecular Weight | 373.63 g/mol |
| Exact Mass | 371.99 |
| IUPAC Name | ethyl 2-[[4-cyano-1-(2,3,4-trichlorophenyl)pyrazol-5-yl]amino]acetate |
| SMILES | CCOC(=O)CNc1c(C#N)cnn1-c1ccc(Cl)c(Cl)c1Cl |
| InChI | InChI=1S/C14H11Cl3N4O2/c1-2-23-11(22)7-19-14-8(5-18)6-20-21(14)10-4-3-9(15)12(16)13(10)17/h3-4,6,19H,2,7H2,1H3 |
| InChIKey | PRIZGFKRXJTSMF-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 79.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 373.63 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|
Analyze ethyl 2-[[4-cyano-1-(2,3,4-trichlorophenyl)pyrazol-5-yl]amino]acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 2-[[4-cyano-1-(2,3,4-trichlorophenyl)pyrazol-5-yl]amino]acetate?
The IUPAC name of ethyl 2-[[4-cyano-1-(2,3,4-trichlorophenyl)pyrazol-5-yl]amino]acetate (CID 13281455) is ethyl 2-[[4-cyano-1-(2,3,4-trichlorophenyl)pyrazol-5-yl]amino]acetate.
What is the SMILES notation for ethyl 2-[[4-cyano-1-(2,3,4-trichlorophenyl)pyrazol-5-yl]amino]acetate?
The canonical SMILES for ethyl 2-[[4-cyano-1-(2,3,4-trichlorophenyl)pyrazol-5-yl]amino]acetate is CCOC(=O)CNc1c(C#N)cnn1-c1ccc(Cl)c(Cl)c1Cl.
What is the InChIKey of ethyl 2-[[4-cyano-1-(2,3,4-trichlorophenyl)pyrazol-5-yl]amino]acetate?
The InChIKey is PRIZGFKRXJTSMF-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H11Cl3N4O2/c1-2-23-11(22)7-19-14-8(5-18)6-20-21(14)10-4-3-9(15)12(16)13(10)17/h3-4,6,19H,2,7H2,1H3.
What are the key properties of ethyl 2-[[4-cyano-1-(2,3,4-trichlorophenyl)pyrazol-5-yl]amino]acetate?
ethyl 2-[[4-cyano-1-(2,3,4-trichlorophenyl)pyrazol-5-yl]amino]acetate has a molecular weight of 373.63 g/mol, XLogP of 3.68, 5 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 2-[[4-cyano-1-(2,3,4-trichlorophenyl)pyrazol-5-yl]amino]acetate is sourced from PubChem (CID 13281455), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).