C13H7F7N4 — CID 13281581
5-(ethylamino)-1-[2,3,5,6-tetrafluoro-4-(trifluoromethyl)phenyl]pyrazole-4-carbonitrile (PubChem CID 13281581) has the molecular formula C13H7F7N4 and a molecular weight of 352.21 g/mol. Its IUPAC name is 5-(ethylamino)-1-[2,3,5,6-tetrafluoro-4-(trifluoromethyl)phenyl]pyrazole-4-carbonitrile.
| Compound Name | 5-(ethylamino)-1-[2,3,5,6-tetrafluoro-4-(trifluoromethyl)phenyl]pyrazole-4-carbonitrile |
|---|---|
| PubChem CID | 13281581 |
| Molecular Formula | C13H7F7N4 |
| Molecular Weight | 352.21 g/mol |
| Exact Mass | 352.06 |
| IUPAC Name | 5-(ethylamino)-1-[2,3,5,6-tetrafluoro-4-(trifluoromethyl)phenyl]pyrazole-4-carbonitrile |
| SMILES | CCNc1c(C#N)cnn1-c1c(F)c(F)c(C(F)(F)F)c(F)c1F |
| InChI | InChI=1S/C13H7F7N4/c1-2-22-12-5(3-21)4-23-24(12)11-9(16)7(14)6(13(18,19)20)8(15)10(11)17/h4,22H,2H2,1H3 |
| InChIKey | DHUPEROHCYFCQB-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 53.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.21 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|