C23H19N3O2S — CID 1328171
2-(2-cyanophenyl)sulfanyl-N-[4-(dimethylcarbamoyl)phenyl]benzamide (PubChem CID 1328171) has the molecular formula C23H19N3O2S and a molecular weight of 401.49 g/mol. Its IUPAC name is 2-(2-cyanophenyl)sulfanyl-N-[4-(dimethylcarbamoyl)phenyl]benzamide.
| Compound Name | 2-(2-cyanophenyl)sulfanyl-N-[4-(dimethylcarbamoyl)phenyl]benzamide |
|---|---|
| PubChem CID | 1328171 |
| Molecular Formula | C23H19N3O2S |
| Molecular Weight | 401.49 g/mol |
| Exact Mass | 401.12 |
| IUPAC Name | 2-(2-cyanophenyl)sulfanyl-N-[4-(dimethylcarbamoyl)phenyl]benzamide |
| SMILES | CN(C)C(=O)c1ccc(NC(=O)c2ccccc2Sc2ccccc2C#N)cc1 |
| InChI | InChI=1S/C23H19N3O2S/c1-26(2)23(28)16-11-13-18(14-12-16)25-22(27)19-8-4-6-10-21(19)29-20-9-5-3-7-17(20)15-24/h3-14H,1-2H3,(H,25,27) |
| InChIKey | IPRLTBMDYPESOB-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 73.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.49 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |