About 1-(4-octylphenoxy)-3-(1,2,4-triazol-1-yl)propan-2-one
1-(4-octylphenoxy)-3-(1,2,4-triazol-1-yl)propan-2-one (PubChem CID 132819844) has the molecular formula C19H27N3O2
and a molecular weight of 329.44 g/mol. Its IUPAC name is 1-(4-octylphenoxy)-3-(1,2,4-triazol-1-yl)propan-2-one.
Molecular Properties
| Compound Name | 1-(4-octylphenoxy)-3-(1,2,4-triazol-1-yl)propan-2-one |
| PubChem CID | 132819844 |
| Molecular Formula | C19H27N3O2 |
| Molecular Weight | 329.44 g/mol |
| Exact Mass | 329.21 |
| IUPAC Name | 1-(4-octylphenoxy)-3-(1,2,4-triazol-1-yl)propan-2-one |
| SMILES | CCCCCCCCc1ccc(OCC(=O)Cn2cncn2)cc1 |
| InChI | InChI=1S/C19H27N3O2/c1-2-3-4-5-6-7-8-17-9-11-19(12-10-17)24-14-18(23)13-22-16-20-15-21-22/h9-12,15-16H,2-8,13-14H2,1H3 |
| InChIKey | CKPVASXTPVICKL-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 57.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 329.44 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 1-(4-octylphenoxy)-3-(1,2,4-triazol-1-yl)propan-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(4-octylphenoxy)-3-(1,2,4-triazol-1-yl)propan-2-one?
The IUPAC name of 1-(4-octylphenoxy)-3-(1,2,4-triazol-1-yl)propan-2-one (CID 132819844) is 1-(4-octylphenoxy)-3-(1,2,4-triazol-1-yl)propan-2-one.
What is the SMILES notation for 1-(4-octylphenoxy)-3-(1,2,4-triazol-1-yl)propan-2-one?
The canonical SMILES for 1-(4-octylphenoxy)-3-(1,2,4-triazol-1-yl)propan-2-one is CCCCCCCCc1ccc(OCC(=O)Cn2cncn2)cc1.
What is the InChIKey of 1-(4-octylphenoxy)-3-(1,2,4-triazol-1-yl)propan-2-one?
The InChIKey is CKPVASXTPVICKL-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H27N3O2/c1-2-3-4-5-6-7-8-17-9-11-19(12-10-17)24-14-18(23)13-22-16-20-15-21-22/h9-12,15-16H,2-8,13-14H2,1H3.
What are the key properties of 1-(4-octylphenoxy)-3-(1,2,4-triazol-1-yl)propan-2-one?
1-(4-octylphenoxy)-3-(1,2,4-triazol-1-yl)propan-2-one has a molecular weight of 329.44 g/mol, XLogP of 3.83, 12 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(4-octylphenoxy)-3-(1,2,4-triazol-1-yl)propan-2-one is sourced from PubChem (CID 132819844), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).