C12H10F3NO2S3 — CID 132819874
5-[[4-(trifluoromethyl)phenyl]methylsulfanyl]thiophene-2-sulfonamide (PubChem CID 132819874) has the molecular formula C12H10F3NO2S3 and a molecular weight of 353.41 g/mol. Its IUPAC name is 5-[[4-(trifluoromethyl)phenyl]methylsulfanyl]thiophene-2-sulfonamide.
| Compound Name | 5-[[4-(trifluoromethyl)phenyl]methylsulfanyl]thiophene-2-sulfonamide |
|---|---|
| PubChem CID | 132819874 |
| Molecular Formula | C12H10F3NO2S3 |
| Molecular Weight | 353.41 g/mol |
| Exact Mass | 352.98 |
| IUPAC Name | 5-[[4-(trifluoromethyl)phenyl]methylsulfanyl]thiophene-2-sulfonamide |
| SMILES | NS(=O)(=O)c1ccc(SCc2ccc(C(F)(F)F)cc2)s1 |
| InChI | InChI=1S/C12H10F3NO2S3/c13-12(14,15)9-3-1-8(2-4-9)7-19-10-5-6-11(20-10)21(16,17)18/h1-6H,7H2,(H2,16,17,18) |
| InChIKey | XRXMPNGFKACJMA-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 60.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.41 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |