About 4-[[(4-carboxy-2,6-dichlorophenyl)methyl-(2-carboxyethyl)amino]methyl]phthalic acid
4-[[(4-carboxy-2,6-dichlorophenyl)methyl-(2-carboxyethyl)amino]methyl]phthalic acid (PubChem CID 132819883) has the molecular formula C20H17Cl2NO8
and a molecular weight of 470.26 g/mol. Its IUPAC name is 4-[[(4-carboxy-2,6-dichlorophenyl)methyl-(2-carboxyethyl)amino]methyl]phthalic acid.
Molecular Properties
| Compound Name | 4-[[(4-carboxy-2,6-dichlorophenyl)methyl-(2-carboxyethyl)amino]methyl]phthalic acid |
| PubChem CID | 132819883 |
| Molecular Formula | C20H17Cl2NO8 |
| Molecular Weight | 470.26 g/mol |
| Exact Mass | 469.03 |
| IUPAC Name | 4-[[(4-carboxy-2,6-dichlorophenyl)methyl-(2-carboxyethyl)amino]methyl]phthalic acid |
| SMILES | O=C(O)CCN(Cc1ccc(C(=O)O)c(C(=O)O)c1)Cc1c(Cl)cc(C(=O)O)cc1Cl |
| InChI | InChI=1S/C20H17Cl2NO8/c21-15-6-11(18(26)27)7-16(22)14(15)9-23(4-3-17(24)25)8-10-1-2-12(19(28)29)13(5-10)20(30)31/h1-2,5-7H,3-4,8-9H2,(H,24,25)(H,26,27)(H,28,29)(H,30,31) |
| InChIKey | IDNAEZURSLAALI-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 152.44 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 470.26 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 4-[[(4-carboxy-2,6-dichlorophenyl)methyl-(2-carboxyethyl)amino]methyl]phthalic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[[(4-carboxy-2,6-dichlorophenyl)methyl-(2-carboxyethyl)amino]methyl]phthalic acid?
The IUPAC name of 4-[[(4-carboxy-2,6-dichlorophenyl)methyl-(2-carboxyethyl)amino]methyl]phthalic acid (CID 132819883) is 4-[[(4-carboxy-2,6-dichlorophenyl)methyl-(2-carboxyethyl)amino]methyl]phthalic acid.
What is the SMILES notation for 4-[[(4-carboxy-2,6-dichlorophenyl)methyl-(2-carboxyethyl)amino]methyl]phthalic acid?
The canonical SMILES for 4-[[(4-carboxy-2,6-dichlorophenyl)methyl-(2-carboxyethyl)amino]methyl]phthalic acid is O=C(O)CCN(Cc1ccc(C(=O)O)c(C(=O)O)c1)Cc1c(Cl)cc(C(=O)O)cc1Cl.
What is the InChIKey of 4-[[(4-carboxy-2,6-dichlorophenyl)methyl-(2-carboxyethyl)amino]methyl]phthalic acid?
The InChIKey is IDNAEZURSLAALI-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H17Cl2NO8/c21-15-6-11(18(26)27)7-16(22)14(15)9-23(4-3-17(24)25)8-10-1-2-12(19(28)29)13(5-10)20(30)31/h1-2,5-7H,3-4,8-9H2,(H,24,25)(H,26,27)(H,28,29)(H,30,31).
What are the key properties of 4-[[(4-carboxy-2,6-dichlorophenyl)methyl-(2-carboxyethyl)amino]methyl]phthalic acid?
4-[[(4-carboxy-2,6-dichlorophenyl)methyl-(2-carboxyethyl)amino]methyl]phthalic acid has a molecular weight of 470.26 g/mol, XLogP of 3.56, 10 rotatable bonds, 4 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[[(4-carboxy-2,6-dichlorophenyl)methyl-(2-carboxyethyl)amino]methyl]phthalic acid is sourced from PubChem (CID 132819883), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).