C30H28Cl2O2 — CID 132819935
(8R,9S,13S,14S)-2,4-bis(4-chlorophenyl)-3-hydroxy-13-methyl-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-17-one (PubChem CID 132819935) has the molecular formula C30H28Cl2O2 and a molecular weight of 491.46 g/mol. Its IUPAC name is (8R,9S,13S,14S)-2,4-bis(4-chlorophenyl)-3-hydroxy-13-methyl-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-17-one.
| Compound Name | (8R,9S,13S,14S)-2,4-bis(4-chlorophenyl)-3-hydroxy-13-methyl-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-17-one |
|---|---|
| PubChem CID | 132819935 |
| Molecular Formula | C30H28Cl2O2 |
| Molecular Weight | 491.46 g/mol |
| Exact Mass | 490.15 |
| IUPAC Name | (8R,9S,13S,14S)-2,4-bis(4-chlorophenyl)-3-hydroxy-13-methyl-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-17-one |
| SMILES | C[C@]12CC[C@@H]3c4cc(-c5ccc(Cl)cc5)c(O)c(-c5ccc(Cl)cc5)c4CC[C@H]3[C@@H]1CCC2=O |
| InChI | InChI=1S/C30H28Cl2O2/c1-30-15-14-21-22(26(30)12-13-27(30)33)10-11-23-25(21)16-24(17-2-6-19(31)7-3-17)29(34)28(23)18-4-8-20(32)9-5-18/h2-9,16,21-22,26,34H,10-15H2,1H3/t21-,22+,26-,30-/m0/s1 |
| InChIKey | ZIEBFAYXCCNKSL-MHFIUEFXSA-N |
| XLogP | 8.46 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.46 |
| LogP ≤ 5 | 8.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |