About tert-butyl N-[(Z)-1,1-bis(1-benzylindol-3-yl)propan-2-ylideneamino]carbamate
tert-butyl N-[(Z)-1,1-bis(1-benzylindol-3-yl)propan-2-ylideneamino]carbamate (PubChem CID 132819967) has the molecular formula C38H38N4O2
and a molecular weight of 582.75 g/mol. Its IUPAC name is tert-butyl N-[(Z)-1,1-bis(1-benzylindol-3-yl)propan-2-ylideneamino]carbamate.
Molecular Properties
| Compound Name | tert-butyl N-[(Z)-1,1-bis(1-benzylindol-3-yl)propan-2-ylideneamino]carbamate |
| PubChem CID | 132819967 |
| Molecular Formula | C38H38N4O2 |
| Molecular Weight | 582.75 g/mol |
| Exact Mass | 582.30 |
| IUPAC Name | tert-butyl N-[(Z)-1,1-bis(1-benzylindol-3-yl)propan-2-ylideneamino]carbamate |
| SMILES | C/C(=N/NC(=O)OC(C)(C)C)C(c1cn(Cc2ccccc2)c2ccccc12)c1cn(Cc2ccccc2)c2ccccc12 |
| InChI | InChI=1S/C38H38N4O2/c1-27(39-40-37(43)44-38(2,3)4)36(32-25-41(23-28-15-7-5-8-16-28)34-21-13-11-19-30(32)34)33-26-42(24-29-17-9-6-10-18-29)35-22-14-12-20-31(33)35/h5-22,25-26,36H,23-24H2,1-4H3,(H,40,43)/b39-27- |
| InChIKey | UMLWJSKSWDJNNQ-NOACJBATSA-N |
| XLogP | 8.73 |
| TPSA | 60.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 44 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 582.75 |
| LogP ≤ 5 | 8.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze tert-butyl N-[(Z)-1,1-bis(1-benzylindol-3-yl)propan-2-ylideneamino]carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl N-[(Z)-1,1-bis(1-benzylindol-3-yl)propan-2-ylideneamino]carbamate?
The IUPAC name of tert-butyl N-[(Z)-1,1-bis(1-benzylindol-3-yl)propan-2-ylideneamino]carbamate (CID 132819967) is tert-butyl N-[(Z)-1,1-bis(1-benzylindol-3-yl)propan-2-ylideneamino]carbamate.
What is the SMILES notation for tert-butyl N-[(Z)-1,1-bis(1-benzylindol-3-yl)propan-2-ylideneamino]carbamate?
The canonical SMILES for tert-butyl N-[(Z)-1,1-bis(1-benzylindol-3-yl)propan-2-ylideneamino]carbamate is C/C(=N/NC(=O)OC(C)(C)C)C(c1cn(Cc2ccccc2)c2ccccc12)c1cn(Cc2ccccc2)c2ccccc12.
What is the InChIKey of tert-butyl N-[(Z)-1,1-bis(1-benzylindol-3-yl)propan-2-ylideneamino]carbamate?
The InChIKey is UMLWJSKSWDJNNQ-NOACJBATSA-N. The full InChI is InChI=1S/C38H38N4O2/c1-27(39-40-37(43)44-38(2,3)4)36(32-25-41(23-28-15-7-5-8-16-28)34-21-13-11-19-30(32)34)33-26-42(24-29-17-9-6-10-18-29)35-22-14-12-20-31(33)35/h5-22,25-26,36H,23-24H2,1-4H3,(H,40,43)/b39-27-.
What are the key properties of tert-butyl N-[(Z)-1,1-bis(1-benzylindol-3-yl)propan-2-ylideneamino]carbamate?
tert-butyl N-[(Z)-1,1-bis(1-benzylindol-3-yl)propan-2-ylideneamino]carbamate has a molecular weight of 582.75 g/mol, XLogP of 8.73, 8 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl N-[(Z)-1,1-bis(1-benzylindol-3-yl)propan-2-ylideneamino]carbamate is sourced from PubChem (CID 132819967), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).