C14H19ClN2O — CID 132820212
(5aR)-10-chloro-9-methoxy-1,2,3,4,5,5a,6,7-octahydro-[1,4]diazepino[1,2-a]quinoline (PubChem CID 132820212) has the molecular formula C14H19ClN2O and a molecular weight of 266.77 g/mol. Its IUPAC name is (5aR)-10-chloro-9-methoxy-1,2,3,4,5,5a,6,7-octahydro-[1,4]diazepino[1,2-a]quinoline.
| Compound Name | (5aR)-10-chloro-9-methoxy-1,2,3,4,5,5a,6,7-octahydro-[1,4]diazepino[1,2-a]quinoline |
|---|---|
| PubChem CID | 132820212 |
| Molecular Formula | C14H19ClN2O |
| Molecular Weight | 266.77 g/mol |
| Exact Mass | 266.12 |
| IUPAC Name | (5aR)-10-chloro-9-methoxy-1,2,3,4,5,5a,6,7-octahydro-[1,4]diazepino[1,2-a]quinoline |
| SMILES | COc1cc2c(cc1Cl)N1CCCNC[C@H]1CC2 |
| InChI | InChI=1S/C14H19ClN2O/c1-18-14-7-10-3-4-11-9-16-5-2-6-17(11)13(10)8-12(14)15/h7-8,11,16H,2-6,9H2,1H3/t11-/m1/s1 |
| InChIKey | YUFHZNAQDXAYLE-LLVKDONJSA-N |
| XLogP | 2.46 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.77 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|