About ethyl 3-(5-cyano-1,3-dimethyl-2-oxoindol-3-yl)-2,2-difluoropropanoate
ethyl 3-(5-cyano-1,3-dimethyl-2-oxoindol-3-yl)-2,2-difluoropropanoate (PubChem CID 132820575) has the molecular formula C16H16F2N2O3
and a molecular weight of 322.31 g/mol. Its IUPAC name is ethyl 3-(5-cyano-1,3-dimethyl-2-oxoindol-3-yl)-2,2-difluoropropanoate.
Molecular Properties
| Compound Name | ethyl 3-(5-cyano-1,3-dimethyl-2-oxoindol-3-yl)-2,2-difluoropropanoate |
| PubChem CID | 132820575 |
| Molecular Formula | C16H16F2N2O3 |
| Molecular Weight | 322.31 g/mol |
| Exact Mass | 322.11 |
| IUPAC Name | ethyl 3-(5-cyano-1,3-dimethyl-2-oxoindol-3-yl)-2,2-difluoropropanoate |
| SMILES | CCOC(=O)C(F)(F)CC1(C)C(=O)N(C)c2ccc(C#N)cc21 |
| InChI | InChI=1S/C16H16F2N2O3/c1-4-23-14(22)16(17,18)9-15(2)11-7-10(8-19)5-6-12(11)20(3)13(15)21/h5-7H,4,9H2,1-3H3 |
| InChIKey | HKSXESAAVRDDMY-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 70.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 322.31 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze ethyl 3-(5-cyano-1,3-dimethyl-2-oxoindol-3-yl)-2,2-difluoropropanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 3-(5-cyano-1,3-dimethyl-2-oxoindol-3-yl)-2,2-difluoropropanoate?
The IUPAC name of ethyl 3-(5-cyano-1,3-dimethyl-2-oxoindol-3-yl)-2,2-difluoropropanoate (CID 132820575) is ethyl 3-(5-cyano-1,3-dimethyl-2-oxoindol-3-yl)-2,2-difluoropropanoate.
What is the SMILES notation for ethyl 3-(5-cyano-1,3-dimethyl-2-oxoindol-3-yl)-2,2-difluoropropanoate?
The canonical SMILES for ethyl 3-(5-cyano-1,3-dimethyl-2-oxoindol-3-yl)-2,2-difluoropropanoate is CCOC(=O)C(F)(F)CC1(C)C(=O)N(C)c2ccc(C#N)cc21.
What is the InChIKey of ethyl 3-(5-cyano-1,3-dimethyl-2-oxoindol-3-yl)-2,2-difluoropropanoate?
The InChIKey is HKSXESAAVRDDMY-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H16F2N2O3/c1-4-23-14(22)16(17,18)9-15(2)11-7-10(8-19)5-6-12(11)20(3)13(15)21/h5-7H,4,9H2,1-3H3.
What are the key properties of ethyl 3-(5-cyano-1,3-dimethyl-2-oxoindol-3-yl)-2,2-difluoropropanoate?
ethyl 3-(5-cyano-1,3-dimethyl-2-oxoindol-3-yl)-2,2-difluoropropanoate has a molecular weight of 322.31 g/mol, XLogP of 2.38, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 3-(5-cyano-1,3-dimethyl-2-oxoindol-3-yl)-2,2-difluoropropanoate is sourced from PubChem (CID 132820575), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).