C14H18ClNO — CID 13282074
1-(4-chlorophenyl)-2-(4-methyl-3,6-dihydro-2H-pyridin-1-yl)ethanol (PubChem CID 13282074) has the molecular formula C14H18ClNO and a molecular weight of 251.76 g/mol. Its IUPAC name is 1-(4-chlorophenyl)-2-(4-methyl-3,6-dihydro-2H-pyridin-1-yl)ethanol.
| Compound Name | 1-(4-chlorophenyl)-2-(4-methyl-3,6-dihydro-2H-pyridin-1-yl)ethanol |
|---|---|
| PubChem CID | 13282074 |
| Molecular Formula | C14H18ClNO |
| Molecular Weight | 251.76 g/mol |
| Exact Mass | 251.11 |
| IUPAC Name | 1-(4-chlorophenyl)-2-(4-methyl-3,6-dihydro-2H-pyridin-1-yl)ethanol |
| SMILES | CC1=CCN(CC(O)c2ccc(Cl)cc2)CC1 |
| InChI | InChI=1S/C14H18ClNO/c1-11-6-8-16(9-7-11)10-14(17)12-2-4-13(15)5-3-12/h2-6,14,17H,7-10H2,1H3 |
| InChIKey | UAXAEIHBHSGPQX-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.76 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|