C35H24NO2P — CID 132820896
2-diphenylphosphoryl-3,4-diphenylpyrrolo[1,2-a]indol-1-one (PubChem CID 132820896) has the molecular formula C35H24NO2P and a molecular weight of 521.56 g/mol. Its IUPAC name is 2-diphenylphosphoryl-3,4-diphenylpyrrolo[1,2-a]indol-1-one.
| Compound Name | 2-diphenylphosphoryl-3,4-diphenylpyrrolo[1,2-a]indol-1-one |
|---|---|
| PubChem CID | 132820896 |
| Molecular Formula | C35H24NO2P |
| Molecular Weight | 521.56 g/mol |
| Exact Mass | 521.15 |
| IUPAC Name | 2-diphenylphosphoryl-3,4-diphenylpyrrolo[1,2-a]indol-1-one |
| SMILES | O=C1C(P(=O)(c2ccccc2)c2ccccc2)=C(c2ccccc2)c2c(-c3ccccc3)c3ccccc3n21 |
| InChI | InChI=1S/C35H24NO2P/c37-35-34(39(38,27-19-9-3-10-20-27)28-21-11-4-12-22-28)32(26-17-7-2-8-18-26)33-31(25-15-5-1-6-16-25)29-23-13-14-24-30(29)36(33)35/h1-24H |
| InChIKey | LANWYICGRBDJPS-UHFFFAOYSA-N |
| XLogP | 7.74 |
| TPSA | 39.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.56 |
| LogP ≤ 5 | 7.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|