C56H74O2 — CID 132820951
5-tert-butyl-2-(4-tert-butylphenyl)-1,3-bis[2-(4-decoxyphenyl)ethynyl]benzene (PubChem CID 132820951) has the molecular formula C56H74O2 and a molecular weight of 779.21 g/mol. Its IUPAC name is 5-tert-butyl-2-(4-tert-butylphenyl)-1,3-bis[2-(4-decoxyphenyl)ethynyl]benzene.
| Compound Name | 5-tert-butyl-2-(4-tert-butylphenyl)-1,3-bis[2-(4-decoxyphenyl)ethynyl]benzene |
|---|---|
| PubChem CID | 132820951 |
| Molecular Formula | C56H74O2 |
| Molecular Weight | 779.21 g/mol |
| Exact Mass | 778.57 |
| IUPAC Name | 5-tert-butyl-2-(4-tert-butylphenyl)-1,3-bis[2-(4-decoxyphenyl)ethynyl]benzene |
| SMILES | CCCCCCCCCCOc1ccc(C#Cc2cc(C(C)(C)C)cc(C#Cc3ccc(OCCCCCCCCCC)cc3)c2-c2ccc(C(C)(C)C)cc2)cc1 |
| InChI | InChI=1S/C56H74O2/c1-9-11-13-15-17-19-21-23-41-57-52-37-27-45(28-38-52)25-31-48-43-51(56(6,7)8)44-49(54(48)47-33-35-50(36-34-47)55(3,4)5)32-26-46-29-39-53(40-30-46)58-42-24-22-20-18-16-14-12-10-2/h27-30,33-40,43-44H,9-24,41-42H2,1-8H3 |
| InChIKey | TXRKAJFAUKBDIG-UHFFFAOYSA-N |
| XLogP | 15.79 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 58 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 779.21 |
| LogP ≤ 5 | 15.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|