About 2-[(1S,2R)-2-butoxycyclopent-3-en-1-yl]ethoxy-tert-butyl-dimethylsilane
2-[(1S,2R)-2-butoxycyclopent-3-en-1-yl]ethoxy-tert-butyl-dimethylsilane (PubChem CID 132821689) has the molecular formula C17H34O2Si
and a molecular weight of 298.54 g/mol. Its IUPAC name is 2-[(1S,2R)-2-butoxycyclopent-3-en-1-yl]ethoxy-tert-butyl-dimethylsilane.
Molecular Properties
| Compound Name | 2-[(1S,2R)-2-butoxycyclopent-3-en-1-yl]ethoxy-tert-butyl-dimethylsilane |
| PubChem CID | 132821689 |
| Molecular Formula | C17H34O2Si |
| Molecular Weight | 298.54 g/mol |
| Exact Mass | 298.23 |
| IUPAC Name | 2-[(1S,2R)-2-butoxycyclopent-3-en-1-yl]ethoxy-tert-butyl-dimethylsilane |
| SMILES | CCCCO[C@H]1C=CC[C@H]1CCO[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C17H34O2Si/c1-7-8-13-18-16-11-9-10-15(16)12-14-19-20(5,6)17(2,3)4/h9,11,15-16H,7-8,10,12-14H2,1-6H3/t15-,16-/m0/s1 |
| InChIKey | VJXIUGLNEPKSRZ-HOTGVXAUSA-N |
| XLogP | 5.16 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 298.54 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 2-[(1S,2R)-2-butoxycyclopent-3-en-1-yl]ethoxy-tert-butyl-dimethylsilane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(1S,2R)-2-butoxycyclopent-3-en-1-yl]ethoxy-tert-butyl-dimethylsilane?
The IUPAC name of 2-[(1S,2R)-2-butoxycyclopent-3-en-1-yl]ethoxy-tert-butyl-dimethylsilane (CID 132821689) is 2-[(1S,2R)-2-butoxycyclopent-3-en-1-yl]ethoxy-tert-butyl-dimethylsilane.
What is the SMILES notation for 2-[(1S,2R)-2-butoxycyclopent-3-en-1-yl]ethoxy-tert-butyl-dimethylsilane?
The canonical SMILES for 2-[(1S,2R)-2-butoxycyclopent-3-en-1-yl]ethoxy-tert-butyl-dimethylsilane is CCCCO[C@H]1C=CC[C@H]1CCO[Si](C)(C)C(C)(C)C.
What is the InChIKey of 2-[(1S,2R)-2-butoxycyclopent-3-en-1-yl]ethoxy-tert-butyl-dimethylsilane?
The InChIKey is VJXIUGLNEPKSRZ-HOTGVXAUSA-N. The full InChI is InChI=1S/C17H34O2Si/c1-7-8-13-18-16-11-9-10-15(16)12-14-19-20(5,6)17(2,3)4/h9,11,15-16H,7-8,10,12-14H2,1-6H3/t15-,16-/m0/s1.
What are the key properties of 2-[(1S,2R)-2-butoxycyclopent-3-en-1-yl]ethoxy-tert-butyl-dimethylsilane?
2-[(1S,2R)-2-butoxycyclopent-3-en-1-yl]ethoxy-tert-butyl-dimethylsilane has a molecular weight of 298.54 g/mol, XLogP of 5.16, 8 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(1S,2R)-2-butoxycyclopent-3-en-1-yl]ethoxy-tert-butyl-dimethylsilane is sourced from PubChem (CID 132821689), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).