C18H19N — CID 132821699
(1R,2S)-6,7-dimethyl-2-phenyl-1,2-dihydronaphthalen-1-amine (PubChem CID 132821699) has the molecular formula C18H19N and a molecular weight of 249.36 g/mol. Its IUPAC name is (1R,2S)-6,7-dimethyl-2-phenyl-1,2-dihydronaphthalen-1-amine.
| Compound Name | (1R,2S)-6,7-dimethyl-2-phenyl-1,2-dihydronaphthalen-1-amine |
|---|---|
| PubChem CID | 132821699 |
| Molecular Formula | C18H19N |
| Molecular Weight | 249.36 g/mol |
| Exact Mass | 249.15 |
| IUPAC Name | (1R,2S)-6,7-dimethyl-2-phenyl-1,2-dihydronaphthalen-1-amine |
| SMILES | Cc1cc2c(cc1C)[C@H](N)[C@H](c1ccccc1)C=C2 |
| InChI | InChI=1S/C18H19N/c1-12-10-15-8-9-16(14-6-4-3-5-7-14)18(19)17(15)11-13(12)2/h3-11,16,18H,19H2,1-2H3/t16-,18+/m0/s1 |
| InChIKey | PEGOFEODSFNHRM-FUHWJXTLSA-N |
| XLogP | 4.11 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.36 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |