C12H17F3N2O — CID 132822072
(1R,4S)-N,N-diethyl-3-(trifluoromethyl)-2-azabicyclo[2.2.1]hept-5-ene-2-carboxamide (PubChem CID 132822072) has the molecular formula C12H17F3N2O and a molecular weight of 262.27 g/mol. Its IUPAC name is (1R,4S)-N,N-diethyl-3-(trifluoromethyl)-2-azabicyclo[2.2.1]hept-5-ene-2-carboxamide.
| Compound Name | (1R,4S)-N,N-diethyl-3-(trifluoromethyl)-2-azabicyclo[2.2.1]hept-5-ene-2-carboxamide |
|---|---|
| PubChem CID | 132822072 |
| Molecular Formula | C12H17F3N2O |
| Molecular Weight | 262.27 g/mol |
| Exact Mass | 262.13 |
| IUPAC Name | (1R,4S)-N,N-diethyl-3-(trifluoromethyl)-2-azabicyclo[2.2.1]hept-5-ene-2-carboxamide |
| SMILES | CCN(CC)C(=O)N1C(C(F)(F)F)[C@@H]2C=C[C@H]1C2 |
| InChI | InChI=1S/C12H17F3N2O/c1-3-16(4-2)11(18)17-9-6-5-8(7-9)10(17)12(13,14)15/h5-6,8-10H,3-4,7H2,1-2H3/t8-,9+,10?/m1/s1 |
| InChIKey | SGUYGTAMKUBOHS-ZDGBYWQASA-N |
| XLogP | 2.64 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.27 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|