C24H15FN2O3S — CID 132822126
3-[2-(4-fluorophenyl)imidazo[2,1-b][1,3]benzothiazol-1-yl]-4-hydroxy-3,4-dihydrochromen-2-one (PubChem CID 132822126) has the molecular formula C24H15FN2O3S and a molecular weight of 430.46 g/mol. Its IUPAC name is 3-[2-(4-fluorophenyl)imidazo[2,1-b][1,3]benzothiazol-1-yl]-4-hydroxy-3,4-dihydrochromen-2-one.
| Compound Name | 3-[2-(4-fluorophenyl)imidazo[2,1-b][1,3]benzothiazol-1-yl]-4-hydroxy-3,4-dihydrochromen-2-one |
|---|---|
| PubChem CID | 132822126 |
| Molecular Formula | C24H15FN2O3S |
| Molecular Weight | 430.46 g/mol |
| Exact Mass | 430.08 |
| IUPAC Name | 3-[2-(4-fluorophenyl)imidazo[2,1-b][1,3]benzothiazol-1-yl]-4-hydroxy-3,4-dihydrochromen-2-one |
| SMILES | O=C1Oc2ccccc2C(O)C1c1c(-c2ccc(F)cc2)nc2sc3ccccc3n12 |
| InChI | InChI=1S/C24H15FN2O3S/c25-14-11-9-13(10-12-14)20-21(27-16-6-2-4-8-18(16)31-24(27)26-20)19-22(28)15-5-1-3-7-17(15)30-23(19)29/h1-12,19,22,28H |
| InChIKey | OFIWPTKLGCFOII-UHFFFAOYSA-N |
| XLogP | 5.09 |
| TPSA | 63.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.46 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|