About azane;2-methyl-5-nitro-1H-imidazole-4-thiol
azane;2-methyl-5-nitro-1H-imidazole-4-thiol (PubChem CID 13282262) has the molecular formula C4H8N4O2S
and a molecular weight of 176.20 g/mol. Its IUPAC name is azane;2-methyl-5-nitro-1H-imidazole-4-thiol.
Molecular Properties
| Compound Name | azane;2-methyl-5-nitro-1H-imidazole-4-thiol |
| PubChem CID | 13282262 |
| Molecular Formula | C4H8N4O2S |
| Molecular Weight | 176.20 g/mol |
| Exact Mass | 176.04 |
| IUPAC Name | azane;2-methyl-5-nitro-1H-imidazole-4-thiol |
| SMILES | Cc1nc(S)c([N+](=O)[O-])[nH]1.N |
| InChI | InChI=1S/C4H5N3O2S.H3N/c1-2-5-3(7(8)9)4(10)6-2;/h10H,1H3,(H,5,6);1H3 |
| InChIKey | LFKJTYVOTACOLH-UHFFFAOYSA-N |
| XLogP | 1.08 |
| TPSA | 106.82 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 176.20 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze azane;2-methyl-5-nitro-1H-imidazole-4-thiol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of azane;2-methyl-5-nitro-1H-imidazole-4-thiol?
The IUPAC name of azane;2-methyl-5-nitro-1H-imidazole-4-thiol (CID 13282262) is azane;2-methyl-5-nitro-1H-imidazole-4-thiol.
What is the SMILES notation for azane;2-methyl-5-nitro-1H-imidazole-4-thiol?
The canonical SMILES for azane;2-methyl-5-nitro-1H-imidazole-4-thiol is Cc1nc(S)c([N+](=O)[O-])[nH]1.N.
What is the InChIKey of azane;2-methyl-5-nitro-1H-imidazole-4-thiol?
The InChIKey is LFKJTYVOTACOLH-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H5N3O2S.H3N/c1-2-5-3(7(8)9)4(10)6-2;/h10H,1H3,(H,5,6);1H3.
What are the key properties of azane;2-methyl-5-nitro-1H-imidazole-4-thiol?
azane;2-methyl-5-nitro-1H-imidazole-4-thiol has a molecular weight of 176.20 g/mol, XLogP of 1.08, 1 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for azane;2-methyl-5-nitro-1H-imidazole-4-thiol is sourced from PubChem (CID 13282262), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).