About (E)-1-cyclopropyl-1-(2,4-dichlorophenyl)-N-[(2-methyl-3-phenylphenyl)methoxy]methanimine
(E)-1-cyclopropyl-1-(2,4-dichlorophenyl)-N-[(2-methyl-3-phenylphenyl)methoxy]methanimine (PubChem CID 13282537) has the molecular formula C24H21Cl2NO
and a molecular weight of 410.34 g/mol. Its IUPAC name is (E)-1-cyclopropyl-1-(2,4-dichlorophenyl)-N-[(2-methyl-3-phenylphenyl)methoxy]methanimine.
Molecular Properties
| Compound Name | (E)-1-cyclopropyl-1-(2,4-dichlorophenyl)-N-[(2-methyl-3-phenylphenyl)methoxy]methanimine |
| PubChem CID | 13282537 |
| Molecular Formula | C24H21Cl2NO |
| Molecular Weight | 410.34 g/mol |
| Exact Mass | 409.10 |
| IUPAC Name | (E)-1-cyclopropyl-1-(2,4-dichlorophenyl)-N-[(2-methyl-3-phenylphenyl)methoxy]methanimine |
| SMILES | Cc1c(CO/N=C(/c2ccc(Cl)cc2Cl)C2CC2)cccc1-c1ccccc1 |
| InChI | InChI=1S/C24H21Cl2NO/c1-16-19(8-5-9-21(16)17-6-3-2-4-7-17)15-28-27-24(18-10-11-18)22-13-12-20(25)14-23(22)26/h2-9,12-14,18H,10-11,15H2,1H3/b27-24+ |
| InChIKey | QEGRUCCAOPRQLO-SOYKGTTHSA-N |
| XLogP | 7.30 |
| TPSA | 21.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 410.34 |
| LogP ≤ 5 | 7.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze (E)-1-cyclopropyl-1-(2,4-dichlorophenyl)-N-[(2-methyl-3-phenylphenyl)methoxy]methanimine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E)-1-cyclopropyl-1-(2,4-dichlorophenyl)-N-[(2-methyl-3-phenylphenyl)methoxy]methanimine?
The IUPAC name of (E)-1-cyclopropyl-1-(2,4-dichlorophenyl)-N-[(2-methyl-3-phenylphenyl)methoxy]methanimine (CID 13282537) is (E)-1-cyclopropyl-1-(2,4-dichlorophenyl)-N-[(2-methyl-3-phenylphenyl)methoxy]methanimine.
What is the SMILES notation for (E)-1-cyclopropyl-1-(2,4-dichlorophenyl)-N-[(2-methyl-3-phenylphenyl)methoxy]methanimine?
The canonical SMILES for (E)-1-cyclopropyl-1-(2,4-dichlorophenyl)-N-[(2-methyl-3-phenylphenyl)methoxy]methanimine is Cc1c(CO/N=C(/c2ccc(Cl)cc2Cl)C2CC2)cccc1-c1ccccc1.
What is the InChIKey of (E)-1-cyclopropyl-1-(2,4-dichlorophenyl)-N-[(2-methyl-3-phenylphenyl)methoxy]methanimine?
The InChIKey is QEGRUCCAOPRQLO-SOYKGTTHSA-N. The full InChI is InChI=1S/C24H21Cl2NO/c1-16-19(8-5-9-21(16)17-6-3-2-4-7-17)15-28-27-24(18-10-11-18)22-13-12-20(25)14-23(22)26/h2-9,12-14,18H,10-11,15H2,1H3/b27-24+.
What are the key properties of (E)-1-cyclopropyl-1-(2,4-dichlorophenyl)-N-[(2-methyl-3-phenylphenyl)methoxy]methanimine?
(E)-1-cyclopropyl-1-(2,4-dichlorophenyl)-N-[(2-methyl-3-phenylphenyl)methoxy]methanimine has a molecular weight of 410.34 g/mol, XLogP of 7.30, 6 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-1-cyclopropyl-1-(2,4-dichlorophenyl)-N-[(2-methyl-3-phenylphenyl)methoxy]methanimine is sourced from PubChem (CID 13282537), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).