About 4-ethyl-5-phenyl-4,5-dihydro-1,3-thiazol-2-amine
4-ethyl-5-phenyl-4,5-dihydro-1,3-thiazol-2-amine (PubChem CID 13282600) has the molecular formula C11H14N2S
and a molecular weight of 206.31 g/mol. Its IUPAC name is 4-ethyl-5-phenyl-4,5-dihydro-1,3-thiazol-2-amine.
Molecular Properties
| Compound Name | 4-ethyl-5-phenyl-4,5-dihydro-1,3-thiazol-2-amine |
| PubChem CID | 13282600 |
| Molecular Formula | C11H14N2S |
| Molecular Weight | 206.31 g/mol |
| Exact Mass | 206.09 |
| IUPAC Name | 4-ethyl-5-phenyl-4,5-dihydro-1,3-thiazol-2-amine |
| SMILES | CCC1N=C(N)SC1c1ccccc1 |
| InChI | InChI=1S/C11H14N2S/c1-2-9-10(14-11(12)13-9)8-6-4-3-5-7-8/h3-7,9-10H,2H2,1H3,(H2,12,13) |
| InChIKey | VBNORIZLQYLGGK-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 38.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 206.31 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-ethyl-5-phenyl-4,5-dihydro-1,3-thiazol-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-ethyl-5-phenyl-4,5-dihydro-1,3-thiazol-2-amine?
The IUPAC name of 4-ethyl-5-phenyl-4,5-dihydro-1,3-thiazol-2-amine (CID 13282600) is 4-ethyl-5-phenyl-4,5-dihydro-1,3-thiazol-2-amine.
What is the SMILES notation for 4-ethyl-5-phenyl-4,5-dihydro-1,3-thiazol-2-amine?
The canonical SMILES for 4-ethyl-5-phenyl-4,5-dihydro-1,3-thiazol-2-amine is CCC1N=C(N)SC1c1ccccc1.
What is the InChIKey of 4-ethyl-5-phenyl-4,5-dihydro-1,3-thiazol-2-amine?
The InChIKey is VBNORIZLQYLGGK-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H14N2S/c1-2-9-10(14-11(12)13-9)8-6-4-3-5-7-8/h3-7,9-10H,2H2,1H3,(H2,12,13).
What are the key properties of 4-ethyl-5-phenyl-4,5-dihydro-1,3-thiazol-2-amine?
4-ethyl-5-phenyl-4,5-dihydro-1,3-thiazol-2-amine has a molecular weight of 206.31 g/mol, XLogP of 2.57, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-ethyl-5-phenyl-4,5-dihydro-1,3-thiazol-2-amine is sourced from PubChem (CID 13282600), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).