C8H5ClF5NO2S — CID 13282739
ethyl 2-chloro-4-(1,1,2,2,2-pentafluoroethyl)-1,3-thiazole-5-carboxylate (PubChem CID 13282739) has the molecular formula C8H5ClF5NO2S and a molecular weight of 309.64 g/mol. Its IUPAC name is ethyl 2-chloro-4-(1,1,2,2,2-pentafluoroethyl)-1,3-thiazole-5-carboxylate.
| Compound Name | ethyl 2-chloro-4-(1,1,2,2,2-pentafluoroethyl)-1,3-thiazole-5-carboxylate |
|---|---|
| PubChem CID | 13282739 |
| Molecular Formula | C8H5ClF5NO2S |
| Molecular Weight | 309.64 g/mol |
| Exact Mass | 308.96 |
| IUPAC Name | ethyl 2-chloro-4-(1,1,2,2,2-pentafluoroethyl)-1,3-thiazole-5-carboxylate |
| SMILES | CCOC(=O)c1sc(Cl)nc1C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C8H5ClF5NO2S/c1-2-17-5(16)3-4(15-6(9)18-3)7(10,11)8(12,13)14/h2H2,1H3 |
| InChIKey | HUJOHPWRRWISPN-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 39.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.64 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|