C8H3ClF7NO2S — CID 13282742
methyl 2-chloro-4-(1,1,2,2,3,3,3-heptafluoropropyl)-1,3-thiazole-5-carboxylate (PubChem CID 13282742) has the molecular formula C8H3ClF7NO2S and a molecular weight of 345.62 g/mol. Its IUPAC name is methyl 2-chloro-4-(1,1,2,2,3,3,3-heptafluoropropyl)-1,3-thiazole-5-carboxylate.
| Compound Name | methyl 2-chloro-4-(1,1,2,2,3,3,3-heptafluoropropyl)-1,3-thiazole-5-carboxylate |
|---|---|
| PubChem CID | 13282742 |
| Molecular Formula | C8H3ClF7NO2S |
| Molecular Weight | 345.62 g/mol |
| Exact Mass | 344.95 |
| IUPAC Name | methyl 2-chloro-4-(1,1,2,2,3,3,3-heptafluoropropyl)-1,3-thiazole-5-carboxylate |
| SMILES | COC(=O)c1sc(Cl)nc1C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C8H3ClF7NO2S/c1-19-4(18)2-3(17-5(9)20-2)6(10,11)7(12,13)8(14,15)16/h1H3 |
| InChIKey | XGPIMNPYXPDDKI-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 39.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.62 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|