About ethyl 2-amino-3-oxobutanoate;hydrochloride
ethyl 2-amino-3-oxobutanoate;hydrochloride (PubChem CID 13282897) has the molecular formula C6H12ClNO3
and a molecular weight of 181.62 g/mol. Its IUPAC name is ethyl 2-amino-3-oxobutanoate;hydrochloride.
Molecular Properties
| Compound Name | ethyl 2-amino-3-oxobutanoate;hydrochloride |
| PubChem CID | 13282897 |
| Molecular Formula | C6H12ClNO3 |
| Molecular Weight | 181.62 g/mol |
| Exact Mass | 181.05 |
| IUPAC Name | ethyl 2-amino-3-oxobutanoate;hydrochloride |
| SMILES | CCOC(=O)C(N)C(C)=O.Cl |
| InChI | InChI=1S/C6H11NO3.ClH/c1-3-10-6(9)5(7)4(2)8;/h5H,3,7H2,1-2H3;1H |
| InChIKey | BGJIQVZAHKXUFG-UHFFFAOYSA-N |
| XLogP | -0.11 |
| TPSA | 69.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 181.62 |
| LogP ≤ 5 | -0.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze ethyl 2-amino-3-oxobutanoate;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 2-amino-3-oxobutanoate;hydrochloride?
The IUPAC name of ethyl 2-amino-3-oxobutanoate;hydrochloride (CID 13282897) is ethyl 2-amino-3-oxobutanoate;hydrochloride.
What is the SMILES notation for ethyl 2-amino-3-oxobutanoate;hydrochloride?
The canonical SMILES for ethyl 2-amino-3-oxobutanoate;hydrochloride is CCOC(=O)C(N)C(C)=O.Cl.
What is the InChIKey of ethyl 2-amino-3-oxobutanoate;hydrochloride?
The InChIKey is BGJIQVZAHKXUFG-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H11NO3.ClH/c1-3-10-6(9)5(7)4(2)8;/h5H,3,7H2,1-2H3;1H.
What are the key properties of ethyl 2-amino-3-oxobutanoate;hydrochloride?
ethyl 2-amino-3-oxobutanoate;hydrochloride has a molecular weight of 181.62 g/mol, XLogP of -0.11, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 2-amino-3-oxobutanoate;hydrochloride is sourced from PubChem (CID 13282897), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).