About 5-azatricyclo[4.3.1.03,8]decan-4-one
5-azatricyclo[4.3.1.03,8]decan-4-one (PubChem CID 13283208) has the molecular formula C9H13NO
and a molecular weight of 151.21 g/mol. Its IUPAC name is 5-azatricyclo[4.3.1.03,8]decan-4-one.
Molecular Properties
| Compound Name | 5-azatricyclo[4.3.1.03,8]decan-4-one |
| PubChem CID | 13283208 |
| Molecular Formula | C9H13NO |
| Molecular Weight | 151.21 g/mol |
| Exact Mass | 151.10 |
| IUPAC Name | 5-azatricyclo[4.3.1.03,8]decan-4-one |
| SMILES | O=C1NC2CC3CC(C2)C1C3 |
| InChI | InChI=1S/C9H13NO/c11-9-8-3-5-1-6(8)4-7(2-5)10-9/h5-8H,1-4H2,(H,10,11) |
| InChIKey | VVUBTAJDTRGQFF-UHFFFAOYSA-N |
| XLogP | 0.92 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 151.21 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 5-azatricyclo[4.3.1.03,8]decan-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-azatricyclo[4.3.1.03,8]decan-4-one?
The IUPAC name of 5-azatricyclo[4.3.1.03,8]decan-4-one (CID 13283208) is 5-azatricyclo[4.3.1.03,8]decan-4-one.
What is the SMILES notation for 5-azatricyclo[4.3.1.03,8]decan-4-one?
The canonical SMILES for 5-azatricyclo[4.3.1.03,8]decan-4-one is O=C1NC2CC3CC(C2)C1C3.
What is the InChIKey of 5-azatricyclo[4.3.1.03,8]decan-4-one?
The InChIKey is VVUBTAJDTRGQFF-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H13NO/c11-9-8-3-5-1-6(8)4-7(2-5)10-9/h5-8H,1-4H2,(H,10,11).
What are the key properties of 5-azatricyclo[4.3.1.03,8]decan-4-one?
5-azatricyclo[4.3.1.03,8]decan-4-one has a molecular weight of 151.21 g/mol, XLogP of 0.92, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 5-azatricyclo[4.3.1.03,8]decan-4-one is sourced from PubChem (CID 13283208), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).