C23H26O6S2 — CID 13283279
[(1S,2R,3S,4R)-3-[(4-methylphenyl)sulfonyloxymethyl]-2-bicyclo[2.2.1]hept-5-enyl]methyl 4-methylbenzenesulfonate (PubChem CID 13283279) has the molecular formula C23H26O6S2 and a molecular weight of 462.59 g/mol. Its IUPAC name is [(1S,2R,3S,4R)-3-[(4-methylphenyl)sulfonyloxymethyl]-2-bicyclo[2.2.1]hept-5-enyl]methyl 4-methylbenzenesulfonate.
| Compound Name | [(1S,2R,3S,4R)-3-[(4-methylphenyl)sulfonyloxymethyl]-2-bicyclo[2.2.1]hept-5-enyl]methyl 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 13283279 |
| Molecular Formula | C23H26O6S2 |
| Molecular Weight | 462.59 g/mol |
| Exact Mass | 462.12 |
| IUPAC Name | [(1S,2R,3S,4R)-3-[(4-methylphenyl)sulfonyloxymethyl]-2-bicyclo[2.2.1]hept-5-enyl]methyl 4-methylbenzenesulfonate |
| SMILES | Cc1ccc(S(=O)(=O)OC[C@@H]2[C@H](COS(=O)(=O)c3ccc(C)cc3)[C@@H]3C=C[C@H]2C3)cc1 |
| InChI | InChI=1S/C23H26O6S2/c1-16-3-9-20(10-4-16)30(24,25)28-14-22-18-7-8-19(13-18)23(22)15-29-31(26,27)21-11-5-17(2)6-12-21/h3-12,18-19,22-23H,13-15H2,1-2H3/t18-,19+,22-,23+ |
| InChIKey | AHVQTTLMPKRSCE-PVTAMDAMSA-N |
| XLogP | 3.85 |
| TPSA | 86.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.59 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|