C7H7BrO3 — CID 13283333
8-bromo-3,6,10-trioxatetracyclo[7.1.0.02,4.05,7]decane (PubChem CID 13283333) has the molecular formula C7H7BrO3 and a molecular weight of 219.03 g/mol. Its IUPAC name is 8-bromo-3,6,10-trioxatetracyclo[7.1.0.02,4.05,7]decane.
| Compound Name | 8-bromo-3,6,10-trioxatetracyclo[7.1.0.02,4.05,7]decane |
|---|---|
| PubChem CID | 13283333 |
| Molecular Formula | C7H7BrO3 |
| Molecular Weight | 219.03 g/mol |
| Exact Mass | 217.96 |
| IUPAC Name | 8-bromo-3,6,10-trioxatetracyclo[7.1.0.02,4.05,7]decane |
| SMILES | BrC1C2OC2C2OC2C2OC12 |
| InChI | InChI=1S/C7H7BrO3/c8-1-2-4(9-2)6-7(11-6)5-3(1)10-5/h1-7H |
| InChIKey | YQNPYNXGVUKESF-UHFFFAOYSA-N |
| XLogP | 0.07 |
| TPSA | 37.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.03 |
| LogP ≤ 5 | 0.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|