C24H32O6 — CID 132837508
(2E,4E,6S,7S)-8-[[(1R,2R,7S,8aR)-1,8a-dimethyl-6-oxo-7-prop-1-en-2-yl-1,2,3,4,7,8-hexahydronaphthalen-2-yl]oxy]-6-hydroxy-7-methyl-8-oxoocta-2,4-dienoic acid (PubChem CID 132837508) has the molecular formula C24H32O6 and a molecular weight of 416.51 g/mol. Its IUPAC name is (2E,4E,6S,7S)-8-[[(1R,2R,7S,8aR)-1,8a-dimethyl-6-oxo-7-prop-1-en-2-yl-1,2,3,4,7,8-hexahydronaphthalen-2-yl]oxy]-6-hydroxy-7-methyl-8-oxoocta-2,4-dienoic acid.
| Compound Name | (2E,4E,6S,7S)-8-[[(1R,2R,7S,8aR)-1,8a-dimethyl-6-oxo-7-prop-1-en-2-yl-1,2,3,4,7,8-hexahydronaphthalen-2-yl]oxy]-6-hydroxy-7-methyl-8-oxoocta-2,4-dienoic acid |
|---|---|
| PubChem CID | 132837508 |
| Molecular Formula | C24H32O6 |
| Molecular Weight | 416.51 g/mol |
| Exact Mass | 416.22 |
| IUPAC Name | (2E,4E,6S,7S)-8-[[(1R,2R,7S,8aR)-1,8a-dimethyl-6-oxo-7-prop-1-en-2-yl-1,2,3,4,7,8-hexahydronaphthalen-2-yl]oxy]-6-hydroxy-7-methyl-8-oxoocta-2,4-dienoic acid |
| SMILES | C=C(C)[C@@H]1C[C@@]2(C)C(=CC1=O)CC[C@@H](OC(=O)[C@@H](C)[C@@H](O)/C=C/C=C/C(=O)O)[C@@H]2C |
| InChI | InChI=1S/C24H32O6/c1-14(2)18-13-24(5)16(4)21(11-10-17(24)12-20(18)26)30-23(29)15(3)19(25)8-6-7-9-22(27)28/h6-9,12,15-16,18-19,21,25H,1,10-11,13H2,2-5H3,(H,27,28)/b8-6+,9-7+/t15-,16-,18-,19-,21+,24+/m0/s1 |
| InChIKey | MMWCHIIGAIJQMV-DHCANEKFSA-N |
| XLogP | 3.62 |
| TPSA | 100.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.51 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|