C17H16F3NO4S — CID 132837547
[8-(piperidine-1-carbonyl)naphthalen-1-yl] trifluoromethanesulfonate (PubChem CID 132837547) has the molecular formula C17H16F3NO4S and a molecular weight of 387.38 g/mol. Its IUPAC name is [8-(piperidine-1-carbonyl)naphthalen-1-yl] trifluoromethanesulfonate.
| Compound Name | [8-(piperidine-1-carbonyl)naphthalen-1-yl] trifluoromethanesulfonate |
|---|---|
| PubChem CID | 132837547 |
| Molecular Formula | C17H16F3NO4S |
| Molecular Weight | 387.38 g/mol |
| Exact Mass | 387.08 |
| IUPAC Name | [8-(piperidine-1-carbonyl)naphthalen-1-yl] trifluoromethanesulfonate |
| SMILES | O=C(c1cccc2cccc(OS(=O)(=O)C(F)(F)F)c12)N1CCCCC1 |
| InChI | InChI=1S/C17H16F3NO4S/c18-17(19,20)26(23,24)25-14-9-5-7-12-6-4-8-13(15(12)14)16(22)21-10-2-1-3-11-21/h4-9H,1-3,10-11H2 |
| InChIKey | NPBGPXNZESLYDI-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.38 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|