C19H22O5 — CID 132837565
(E)-2-[(3R,6R,7R)-3-methyl-10-oxo-6-[(E)-prop-1-enyl]-2,4,11-trioxatricyclo[7.4.0.03,7]trideca-1(9),12-dien-13-yl]pent-2-enal (PubChem CID 132837565) has the molecular formula C19H22O5 and a molecular weight of 330.38 g/mol. Its IUPAC name is (E)-2-[(3R,6R,7R)-3-methyl-10-oxo-6-[(E)-prop-1-enyl]-2,4,11-trioxatricyclo[7.4.0.03,7]trideca-1(9),12-dien-13-yl]pent-2-enal.
| Compound Name | (E)-2-[(3R,6R,7R)-3-methyl-10-oxo-6-[(E)-prop-1-enyl]-2,4,11-trioxatricyclo[7.4.0.03,7]trideca-1(9),12-dien-13-yl]pent-2-enal |
|---|---|
| PubChem CID | 132837565 |
| Molecular Formula | C19H22O5 |
| Molecular Weight | 330.38 g/mol |
| Exact Mass | 330.15 |
| IUPAC Name | (E)-2-[(3R,6R,7R)-3-methyl-10-oxo-6-[(E)-prop-1-enyl]-2,4,11-trioxatricyclo[7.4.0.03,7]trideca-1(9),12-dien-13-yl]pent-2-enal |
| SMILES | C/C=C/[C@H]1CO[C@]2(C)Oc3c(/C(C=O)=C\CC)coc(=O)c3C[C@H]12 |
| InChI | InChI=1S/C19H22O5/c1-4-6-12(9-20)15-11-22-18(21)14-8-16-13(7-5-2)10-23-19(16,3)24-17(14)15/h5-7,9,11,13,16H,4,8,10H2,1-3H3/b7-5+,12-6-/t13-,16+,19+/m0/s1 |
| InChIKey | XCCRIMCUROIIKJ-VEOLBBLCSA-N |
| XLogP | 3.12 |
| TPSA | 65.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.38 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|