C45H46N6O2 — CID 132837665
N,N'-bis[[1-(4-methoxyphenyl)-9-methylpyrido[3,4-b]indol-3-yl]methyl]pentane-1,5-diamine (PubChem CID 132837665) has the molecular formula C45H46N6O2 and a molecular weight of 702.90 g/mol. Its IUPAC name is N,N'-bis[[1-(4-methoxyphenyl)-9-methylpyrido[3,4-b]indol-3-yl]methyl]pentane-1,5-diamine.
| Compound Name | N,N'-bis[[1-(4-methoxyphenyl)-9-methylpyrido[3,4-b]indol-3-yl]methyl]pentane-1,5-diamine |
|---|---|
| PubChem CID | 132837665 |
| Molecular Formula | C45H46N6O2 |
| Molecular Weight | 702.90 g/mol |
| Exact Mass | 702.37 |
| IUPAC Name | N,N'-bis[[1-(4-methoxyphenyl)-9-methylpyrido[3,4-b]indol-3-yl]methyl]pentane-1,5-diamine |
| SMILES | COc1ccc(-c2nc(CNCCCCCNCc3cc4c5ccccc5n(C)c4c(-c4ccc(OC)cc4)n3)cc3c4ccccc4n(C)c23)cc1 |
| InChI | InChI=1S/C45H46N6O2/c1-50-40-14-8-6-12-36(40)38-26-32(48-42(44(38)50)30-16-20-34(52-3)21-17-30)28-46-24-10-5-11-25-47-29-33-27-39-37-13-7-9-15-41(37)51(2)45(39)43(49-33)31-18-22-35(53-4)23-19-31/h6-9,12-23,26-27,46-47H,5,10-11,24-25,28-29H2,1-4H3 |
| InChIKey | YUZCMOFPTFOMAQ-UHFFFAOYSA-N |
| XLogP | 9.17 |
| TPSA | 78.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 702.90 |
| LogP ≤ 5 | 9.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|