C21H18N2O2 — CID 132838135
(3Z,6Z)-3,6-dibenzylidene-1-prop-2-enylpiperazine-2,5-dione (PubChem CID 132838135) has the molecular formula C21H18N2O2 and a molecular weight of 330.39 g/mol. Its IUPAC name is (3Z,6Z)-3,6-dibenzylidene-1-prop-2-enylpiperazine-2,5-dione.
| Compound Name | (3Z,6Z)-3,6-dibenzylidene-1-prop-2-enylpiperazine-2,5-dione |
|---|---|
| PubChem CID | 132838135 |
| Molecular Formula | C21H18N2O2 |
| Molecular Weight | 330.39 g/mol |
| Exact Mass | 330.14 |
| IUPAC Name | (3Z,6Z)-3,6-dibenzylidene-1-prop-2-enylpiperazine-2,5-dione |
| SMILES | C=CCn1c(=O)/c(=C/c2ccccc2)[nH]c(=O)/c1=C/c1ccccc1 |
| InChI | InChI=1S/C21H18N2O2/c1-2-13-23-19(15-17-11-7-4-8-12-17)20(24)22-18(21(23)25)14-16-9-5-3-6-10-16/h2-12,14-15H,1,13H2,(H,22,24)/b18-14-,19-15- |
| InChIKey | MDRQRUXTPJUFCH-DJTQBEGKSA-N |
| XLogP | 1.38 |
| TPSA | 54.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.39 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|