C36H20Cl5F — CID 132838164
1,2,3,4,5-pentakis(4-chlorophenyl)-6-fluorobenzene (PubChem CID 132838164) has the molecular formula C36H20Cl5F and a molecular weight of 648.82 g/mol. Its IUPAC name is 1,2,3,4,5-pentakis(4-chlorophenyl)-6-fluorobenzene.
| Compound Name | 1,2,3,4,5-pentakis(4-chlorophenyl)-6-fluorobenzene |
|---|---|
| PubChem CID | 132838164 |
| Molecular Formula | C36H20Cl5F |
| Molecular Weight | 648.82 g/mol |
| Exact Mass | 646.00 |
| IUPAC Name | 1,2,3,4,5-pentakis(4-chlorophenyl)-6-fluorobenzene |
| SMILES | Fc1c(-c2ccc(Cl)cc2)c(-c2ccc(Cl)cc2)c(-c2ccc(Cl)cc2)c(-c2ccc(Cl)cc2)c1-c1ccc(Cl)cc1 |
| InChI | InChI=1S/C36H20Cl5F/c37-26-11-1-21(2-12-26)31-32(22-3-13-27(38)14-4-22)34(24-7-17-29(40)18-8-24)36(42)35(25-9-19-30(41)20-10-25)33(31)23-5-15-28(39)16-6-23/h1-20H |
| InChIKey | IOONJPMKZFFMGP-UHFFFAOYSA-N |
| XLogP | 13.43 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 648.82 |
| LogP ≤ 5 | 13.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |