C21H32O6Si — CID 132838442
7-O-ethyl 1-O-methyl (1S,2S,5R,8R)-5-[tert-butyl(dimethyl)silyl]oxy-11-oxatricyclo[6.2.1.02,6]undeca-6,9-diene-1,7-dicarboxylate (PubChem CID 132838442) has the molecular formula C21H32O6Si and a molecular weight of 408.57 g/mol. Its IUPAC name is 7-O-ethyl 1-O-methyl (1S,2S,5R,8R)-5-[tert-butyl(dimethyl)silyl]oxy-11-oxatricyclo[6.2.1.02,6]undeca-6,9-diene-1,7-dicarboxylate.
| Compound Name | 7-O-ethyl 1-O-methyl (1S,2S,5R,8R)-5-[tert-butyl(dimethyl)silyl]oxy-11-oxatricyclo[6.2.1.02,6]undeca-6,9-diene-1,7-dicarboxylate |
|---|---|
| PubChem CID | 132838442 |
| Molecular Formula | C21H32O6Si |
| Molecular Weight | 408.57 g/mol |
| Exact Mass | 408.20 |
| IUPAC Name | 7-O-ethyl 1-O-methyl (1S,2S,5R,8R)-5-[tert-butyl(dimethyl)silyl]oxy-11-oxatricyclo[6.2.1.02,6]undeca-6,9-diene-1,7-dicarboxylate |
| SMILES | CCOC(=O)C1=C2[C@H](O[Si](C)(C)C(C)(C)C)CC[C@@H]2[C@]2(C(=O)OC)C=C[C@H]1O2 |
| InChI | InChI=1S/C21H32O6Si/c1-8-25-18(22)17-14-11-12-21(26-14,19(23)24-5)13-9-10-15(16(13)17)27-28(6,7)20(2,3)4/h11-15H,8-10H2,1-7H3/t13-,14+,15+,21-/m0/s1 |
| InChIKey | VFQRXNBTFJGOLC-ZLOLFTAESA-N |
| XLogP | 3.53 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.57 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|