About 2-(3-chlorophenyl)ethyl benzoate
2-(3-chlorophenyl)ethyl benzoate (PubChem CID 132838767) has the molecular formula C15H13ClO2
and a molecular weight of 260.72 g/mol. Its IUPAC name is 2-(3-chlorophenyl)ethyl benzoate.
Molecular Properties
| Compound Name | 2-(3-chlorophenyl)ethyl benzoate |
| PubChem CID | 132838767 |
| Molecular Formula | C15H13ClO2 |
| Molecular Weight | 260.72 g/mol |
| Exact Mass | 260.06 |
| IUPAC Name | 2-(3-chlorophenyl)ethyl benzoate |
| SMILES | O=C(OCCc1cccc(Cl)c1)c1ccccc1 |
| InChI | InChI=1S/C15H13ClO2/c16-14-8-4-5-12(11-14)9-10-18-15(17)13-6-2-1-3-7-13/h1-8,11H,9-10H2 |
| InChIKey | BTLSETYNLKGWAQ-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 260.72 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-(3-chlorophenyl)ethyl benzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(3-chlorophenyl)ethyl benzoate?
The IUPAC name of 2-(3-chlorophenyl)ethyl benzoate (CID 132838767) is 2-(3-chlorophenyl)ethyl benzoate.
What is the SMILES notation for 2-(3-chlorophenyl)ethyl benzoate?
The canonical SMILES for 2-(3-chlorophenyl)ethyl benzoate is O=C(OCCc1cccc(Cl)c1)c1ccccc1.
What is the InChIKey of 2-(3-chlorophenyl)ethyl benzoate?
The InChIKey is BTLSETYNLKGWAQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H13ClO2/c16-14-8-4-5-12(11-14)9-10-18-15(17)13-6-2-1-3-7-13/h1-8,11H,9-10H2.
What are the key properties of 2-(3-chlorophenyl)ethyl benzoate?
2-(3-chlorophenyl)ethyl benzoate has a molecular weight of 260.72 g/mol, XLogP of 3.74, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(3-chlorophenyl)ethyl benzoate is sourced from PubChem (CID 132838767), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).