C16H20O3 — CID 132838806
[(1R,5R,8R,9R)-1-(methoxymethyl)-8-tetracyclo[6.3.1.02,11.05,9]dodeca-3,6-dienyl] acetate (PubChem CID 132838806) has the molecular formula C16H20O3 and a molecular weight of 260.33 g/mol. Its IUPAC name is [(1R,5R,8R,9R)-1-(methoxymethyl)-8-tetracyclo[6.3.1.02,11.05,9]dodeca-3,6-dienyl] acetate.
| Compound Name | [(1R,5R,8R,9R)-1-(methoxymethyl)-8-tetracyclo[6.3.1.02,11.05,9]dodeca-3,6-dienyl] acetate |
|---|---|
| PubChem CID | 132838806 |
| Molecular Formula | C16H20O3 |
| Molecular Weight | 260.33 g/mol |
| Exact Mass | 260.14 |
| IUPAC Name | [(1R,5R,8R,9R)-1-(methoxymethyl)-8-tetracyclo[6.3.1.02,11.05,9]dodeca-3,6-dienyl] acetate |
| SMILES | COC[C@@]12C[C@@]3(OC(C)=O)C=C[C@H]4C=CC1C2C[C@H]43 |
| InChI | InChI=1S/C16H20O3/c1-10(17)19-16-6-5-11-3-4-12-14(7-13(11)16)15(12,8-16)9-18-2/h3-6,11-14H,7-9H2,1-2H3/t11-,12?,13-,14?,15+,16+/m1/s1 |
| InChIKey | BWRXQYZAPBCCJX-OJTHXENHSA-N |
| XLogP | 2.33 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.33 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|