C11H17Cl2NO2 — CID 132843684
N-[(3-chloro-4-methoxyphenyl)methyl]-2-methoxyethanamine;hydrochloride (PubChem CID 132843684) has the molecular formula C11H17Cl2NO2 and a molecular weight of 266.17 g/mol. Its IUPAC name is N-[(3-chloro-4-methoxyphenyl)methyl]-2-methoxyethanamine;hydrochloride.
| Compound Name | N-[(3-chloro-4-methoxyphenyl)methyl]-2-methoxyethanamine;hydrochloride |
|---|---|
| PubChem CID | 132843684 |
| Molecular Formula | C11H17Cl2NO2 |
| Molecular Weight | 266.17 g/mol |
| Exact Mass | 265.06 |
| IUPAC Name | N-[(3-chloro-4-methoxyphenyl)methyl]-2-methoxyethanamine;hydrochloride |
| SMILES | COCCNCc1ccc(OC)c(Cl)c1.Cl |
| InChI | InChI=1S/C11H16ClNO2.ClH/c1-14-6-5-13-8-9-3-4-11(15-2)10(12)7-9;/h3-4,7,13H,5-6,8H2,1-2H3;1H |
| InChIKey | JZKCKNSLQZHBRB-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.17 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|