C7H11N5O — CID 132849067
N-[2-(1,2,4-triazin-3-ylamino)ethyl]acetamide (PubChem CID 132849067) has the molecular formula C7H11N5O and a molecular weight of 181.20 g/mol. Its IUPAC name is N-[2-(1,2,4-triazin-3-ylamino)ethyl]acetamide.
| Compound Name | N-[2-(1,2,4-triazin-3-ylamino)ethyl]acetamide |
|---|---|
| PubChem CID | 132849067 |
| Molecular Formula | C7H11N5O |
| Molecular Weight | 181.20 g/mol |
| Exact Mass | 181.10 |
| IUPAC Name | N-[2-(1,2,4-triazin-3-ylamino)ethyl]acetamide |
| SMILES | CC(=O)NCCNc1nccnn1 |
| InChI | InChI=1S/C7H11N5O/c1-6(13)8-2-3-9-7-10-4-5-11-12-7/h4-5H,2-3H2,1H3,(H,8,13)(H,9,10,12) |
| InChIKey | RRYUMCOYEUXJMY-UHFFFAOYSA-N |
| XLogP | -0.58 |
| TPSA | 79.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 181.20 |
| LogP ≤ 5 | -0.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|