C16H29NO2 — CID 132849617
1-[(5R,8R,8aS)-5-butyl-8-(2-hydroxyethyl)-2,3,5,6,7,8-hexahydro-1H-indolizin-8a-yl]ethanone (PubChem CID 132849617) has the molecular formula C16H29NO2 and a molecular weight of 267.41 g/mol. Its IUPAC name is 1-[(5R,8R,8aS)-5-butyl-8-(2-hydroxyethyl)-2,3,5,6,7,8-hexahydro-1H-indolizin-8a-yl]ethanone.
| Compound Name | 1-[(5R,8R,8aS)-5-butyl-8-(2-hydroxyethyl)-2,3,5,6,7,8-hexahydro-1H-indolizin-8a-yl]ethanone |
|---|---|
| PubChem CID | 132849617 |
| Molecular Formula | C16H29NO2 |
| Molecular Weight | 267.41 g/mol |
| Exact Mass | 267.22 |
| IUPAC Name | 1-[(5R,8R,8aS)-5-butyl-8-(2-hydroxyethyl)-2,3,5,6,7,8-hexahydro-1H-indolizin-8a-yl]ethanone |
| SMILES | CCCC[C@@H]1CC[C@H](CCO)[C@]2(C(C)=O)CCCN12 |
| InChI | InChI=1S/C16H29NO2/c1-3-4-6-15-8-7-14(9-12-18)16(13(2)19)10-5-11-17(15)16/h14-15,18H,3-12H2,1-2H3/t14-,15-,16-/m1/s1 |
| InChIKey | IWLSROJORDSBPQ-BZUAXINKSA-N |
| XLogP | 2.76 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.41 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |