C27H28N2O — CID 132849954
6,8-ditert-butyl-10-oxa-2,21-diazapentacyclo[12.8.0.03,12.04,9.015,20]docosa-1(14),2,4(9),5,7,12,15,17,19,21-decaene (PubChem CID 132849954) has the molecular formula C27H28N2O and a molecular weight of 396.53 g/mol. Its IUPAC name is 6,8-ditert-butyl-10-oxa-2,21-diazapentacyclo[12.8.0.03,12.04,9.015,20]docosa-1(14),2,4(9),5,7,12,15,17,19,21-decaene.
| Compound Name | 6,8-ditert-butyl-10-oxa-2,21-diazapentacyclo[12.8.0.03,12.04,9.015,20]docosa-1(14),2,4(9),5,7,12,15,17,19,21-decaene |
|---|---|
| PubChem CID | 132849954 |
| Molecular Formula | C27H28N2O |
| Molecular Weight | 396.53 g/mol |
| Exact Mass | 396.22 |
| IUPAC Name | 6,8-ditert-butyl-10-oxa-2,21-diazapentacyclo[12.8.0.03,12.04,9.015,20]docosa-1(14),2,4(9),5,7,12,15,17,19,21-decaene |
| SMILES | CC(C)(C)c1cc2c(c(C(C)(C)C)c1)OCc1cc3c(cnc4ccccc43)nc1-2 |
| InChI | InChI=1S/C27H28N2O/c1-26(2,3)17-12-20-24-16(15-30-25(20)21(13-17)27(4,5)6)11-19-18-9-7-8-10-22(18)28-14-23(19)29-24/h7-14H,15H2,1-6H3 |
| InChIKey | GIQZGOOLUSXAJJ-UHFFFAOYSA-N |
| XLogP | 6.94 |
| TPSA | 35.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.53 |
| LogP ≤ 5 | 6.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|