About 3-(4-bromophenyl)-1-(4-methoxyphenyl)benzo[f][1,7]naphthyridine
3-(4-bromophenyl)-1-(4-methoxyphenyl)benzo[f][1,7]naphthyridine (PubChem CID 132849963) has the molecular formula C25H17BrN2O
and a molecular weight of 441.33 g/mol. Its IUPAC name is 3-(4-bromophenyl)-1-(4-methoxyphenyl)benzo[f][1,7]naphthyridine.
Molecular Properties
| Compound Name | 3-(4-bromophenyl)-1-(4-methoxyphenyl)benzo[f][1,7]naphthyridine |
| PubChem CID | 132849963 |
| Molecular Formula | C25H17BrN2O |
| Molecular Weight | 441.33 g/mol |
| Exact Mass | 440.05 |
| IUPAC Name | 3-(4-bromophenyl)-1-(4-methoxyphenyl)benzo[f][1,7]naphthyridine |
| SMILES | COc1ccc(-c2cc(-c3ccc(Br)cc3)nc3cnc4ccccc4c23)cc1 |
| InChI | InChI=1S/C25H17BrN2O/c1-29-19-12-8-16(9-13-19)21-14-23(17-6-10-18(26)11-7-17)28-24-15-27-22-5-3-2-4-20(22)25(21)24/h2-15H,1H3 |
| InChIKey | WQVBCRPFMWKAKH-UHFFFAOYSA-N |
| XLogP | 6.89 |
| TPSA | 35.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 441.33 |
| LogP ≤ 5 | 6.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|
Analyze 3-(4-bromophenyl)-1-(4-methoxyphenyl)benzo[f][1,7]naphthyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(4-bromophenyl)-1-(4-methoxyphenyl)benzo[f][1,7]naphthyridine?
The IUPAC name of 3-(4-bromophenyl)-1-(4-methoxyphenyl)benzo[f][1,7]naphthyridine (CID 132849963) is 3-(4-bromophenyl)-1-(4-methoxyphenyl)benzo[f][1,7]naphthyridine.
What is the SMILES notation for 3-(4-bromophenyl)-1-(4-methoxyphenyl)benzo[f][1,7]naphthyridine?
The canonical SMILES for 3-(4-bromophenyl)-1-(4-methoxyphenyl)benzo[f][1,7]naphthyridine is COc1ccc(-c2cc(-c3ccc(Br)cc3)nc3cnc4ccccc4c23)cc1.
What is the InChIKey of 3-(4-bromophenyl)-1-(4-methoxyphenyl)benzo[f][1,7]naphthyridine?
The InChIKey is WQVBCRPFMWKAKH-UHFFFAOYSA-N. The full InChI is InChI=1S/C25H17BrN2O/c1-29-19-12-8-16(9-13-19)21-14-23(17-6-10-18(26)11-7-17)28-24-15-27-22-5-3-2-4-20(22)25(21)24/h2-15H,1H3.
What are the key properties of 3-(4-bromophenyl)-1-(4-methoxyphenyl)benzo[f][1,7]naphthyridine?
3-(4-bromophenyl)-1-(4-methoxyphenyl)benzo[f][1,7]naphthyridine has a molecular weight of 441.33 g/mol, XLogP of 6.89, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(4-bromophenyl)-1-(4-methoxyphenyl)benzo[f][1,7]naphthyridine is sourced from PubChem (CID 132849963), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).