About [(2S)-5-oxo-4,4-diphenyloxolan-2-yl]methyl 4-methylbenzenesulfonate
[(2S)-5-oxo-4,4-diphenyloxolan-2-yl]methyl 4-methylbenzenesulfonate (PubChem CID 132850182) has the molecular formula C24H22O5S
and a molecular weight of 422.50 g/mol. Its IUPAC name is [(2S)-5-oxo-4,4-diphenyloxolan-2-yl]methyl 4-methylbenzenesulfonate.
Molecular Properties
| Compound Name | [(2S)-5-oxo-4,4-diphenyloxolan-2-yl]methyl 4-methylbenzenesulfonate |
| PubChem CID | 132850182 |
| Molecular Formula | C24H22O5S |
| Molecular Weight | 422.50 g/mol |
| Exact Mass | 422.12 |
| IUPAC Name | [(2S)-5-oxo-4,4-diphenyloxolan-2-yl]methyl 4-methylbenzenesulfonate |
| SMILES | Cc1ccc(S(=O)(=O)OC[C@@H]2CC(c3ccccc3)(c3ccccc3)C(=O)O2)cc1 |
| InChI | InChI=1S/C24H22O5S/c1-18-12-14-22(15-13-18)30(26,27)28-17-21-16-24(23(25)29-21,19-8-4-2-5-9-19)20-10-6-3-7-11-20/h2-15,21H,16-17H2,1H3/t21-/m0/s1 |
| InChIKey | VPMYHHYAUWAJHR-NRFANRHFSA-N |
| XLogP | 4.00 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 422.50 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|
Analyze [(2S)-5-oxo-4,4-diphenyloxolan-2-yl]methyl 4-methylbenzenesulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(2S)-5-oxo-4,4-diphenyloxolan-2-yl]methyl 4-methylbenzenesulfonate?
The IUPAC name of [(2S)-5-oxo-4,4-diphenyloxolan-2-yl]methyl 4-methylbenzenesulfonate (CID 132850182) is [(2S)-5-oxo-4,4-diphenyloxolan-2-yl]methyl 4-methylbenzenesulfonate.
What is the SMILES notation for [(2S)-5-oxo-4,4-diphenyloxolan-2-yl]methyl 4-methylbenzenesulfonate?
The canonical SMILES for [(2S)-5-oxo-4,4-diphenyloxolan-2-yl]methyl 4-methylbenzenesulfonate is Cc1ccc(S(=O)(=O)OC[C@@H]2CC(c3ccccc3)(c3ccccc3)C(=O)O2)cc1.
What is the InChIKey of [(2S)-5-oxo-4,4-diphenyloxolan-2-yl]methyl 4-methylbenzenesulfonate?
The InChIKey is VPMYHHYAUWAJHR-NRFANRHFSA-N. The full InChI is InChI=1S/C24H22O5S/c1-18-12-14-22(15-13-18)30(26,27)28-17-21-16-24(23(25)29-21,19-8-4-2-5-9-19)20-10-6-3-7-11-20/h2-15,21H,16-17H2,1H3/t21-/m0/s1.
What are the key properties of [(2S)-5-oxo-4,4-diphenyloxolan-2-yl]methyl 4-methylbenzenesulfonate?
[(2S)-5-oxo-4,4-diphenyloxolan-2-yl]methyl 4-methylbenzenesulfonate has a molecular weight of 422.50 g/mol, XLogP of 4.00, 6 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [(2S)-5-oxo-4,4-diphenyloxolan-2-yl]methyl 4-methylbenzenesulfonate is sourced from PubChem (CID 132850182), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).