C26H22ClNO2 — CID 132850354
4-benzoyl-6-chloro-1-[(2,4,6-trimethylphenyl)methyl]quinolin-2-one (PubChem CID 132850354) has the molecular formula C26H22ClNO2 and a molecular weight of 415.92 g/mol. Its IUPAC name is 4-benzoyl-6-chloro-1-[(2,4,6-trimethylphenyl)methyl]quinolin-2-one.
| Compound Name | 4-benzoyl-6-chloro-1-[(2,4,6-trimethylphenyl)methyl]quinolin-2-one |
|---|---|
| PubChem CID | 132850354 |
| Molecular Formula | C26H22ClNO2 |
| Molecular Weight | 415.92 g/mol |
| Exact Mass | 415.13 |
| IUPAC Name | 4-benzoyl-6-chloro-1-[(2,4,6-trimethylphenyl)methyl]quinolin-2-one |
| SMILES | Cc1cc(C)c(Cn2c(=O)cc(C(=O)c3ccccc3)c3cc(Cl)ccc32)c(C)c1 |
| InChI | InChI=1S/C26H22ClNO2/c1-16-11-17(2)23(18(3)12-16)15-28-24-10-9-20(27)13-21(24)22(14-25(28)29)26(30)19-7-5-4-6-8-19/h4-14H,15H2,1-3H3 |
| InChIKey | NGKSJMZXQHVZLO-UHFFFAOYSA-N |
| XLogP | 5.86 |
| TPSA | 39.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.92 |
| LogP ≤ 5 | 5.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |