C12H18O6 — CID 132850629
[(2S,3R,4R,5S,6R)-2,6-diformyl-2-methoxy-3,5-dimethyloxan-4-yl] acetate (PubChem CID 132850629) has the molecular formula C12H18O6 and a molecular weight of 258.27 g/mol. Its IUPAC name is [(2S,3R,4R,5S,6R)-2,6-diformyl-2-methoxy-3,5-dimethyloxan-4-yl] acetate.
| Compound Name | [(2S,3R,4R,5S,6R)-2,6-diformyl-2-methoxy-3,5-dimethyloxan-4-yl] acetate |
|---|---|
| PubChem CID | 132850629 |
| Molecular Formula | C12H18O6 |
| Molecular Weight | 258.27 g/mol |
| Exact Mass | 258.11 |
| IUPAC Name | [(2S,3R,4R,5S,6R)-2,6-diformyl-2-methoxy-3,5-dimethyloxan-4-yl] acetate |
| SMILES | CO[C@]1(C=O)O[C@@H](C=O)[C@@H](C)[C@@H](OC(C)=O)[C@H]1C |
| InChI | InChI=1S/C12H18O6/c1-7-10(5-13)18-12(6-14,16-4)8(2)11(7)17-9(3)15/h5-8,10-11H,1-4H3/t7-,8-,10+,11-,12-/m1/s1 |
| InChIKey | XZTKLSOFGYRLPC-LRBIJROPSA-N |
| XLogP | 0.33 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.27 |
| LogP ≤ 5 | 0.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|