C13H20O3 — CID 13285079
ethyl 7a-hydroxy-2-methylidene-1,3,4,5,6,7-hexahydroindene-3a-carboxylate (PubChem CID 13285079) has the molecular formula C13H20O3 and a molecular weight of 224.30 g/mol. Its IUPAC name is ethyl 7a-hydroxy-2-methylidene-1,3,4,5,6,7-hexahydroindene-3a-carboxylate.
| Compound Name | ethyl 7a-hydroxy-2-methylidene-1,3,4,5,6,7-hexahydroindene-3a-carboxylate |
|---|---|
| PubChem CID | 13285079 |
| Molecular Formula | C13H20O3 |
| Molecular Weight | 224.30 g/mol |
| Exact Mass | 224.14 |
| IUPAC Name | ethyl 7a-hydroxy-2-methylidene-1,3,4,5,6,7-hexahydroindene-3a-carboxylate |
| SMILES | C=C1CC2(O)CCCCC2(C(=O)OCC)C1 |
| InChI | InChI=1S/C13H20O3/c1-3-16-11(14)12-6-4-5-7-13(12,15)9-10(2)8-12/h15H,2-9H2,1H3 |
| InChIKey | NXKYIAQCEPRCDO-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.30 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|