C32H39N3 — CID 132851129
(1S,8S,15S)-22-methyl-1,8,15-tripropylhexacyclo[13.6.1.02,7.08,22.09,14.016,21]docosa-2(7),3,5,9(14),10,12,16(21),17,19-nonaene-4,11,18-triamine (PubChem CID 132851129) has the molecular formula C32H39N3 and a molecular weight of 465.69 g/mol. Its IUPAC name is (1S,8S,15S)-22-methyl-1,8,15-tripropylhexacyclo[13.6.1.02,7.08,22.09,14.016,21]docosa-2(7),3,5,9(14),10,12,16(21),17,19-nonaene-4,11,18-triamine.
| Compound Name | (1S,8S,15S)-22-methyl-1,8,15-tripropylhexacyclo[13.6.1.02,7.08,22.09,14.016,21]docosa-2(7),3,5,9(14),10,12,16(21),17,19-nonaene-4,11,18-triamine |
|---|---|
| PubChem CID | 132851129 |
| Molecular Formula | C32H39N3 |
| Molecular Weight | 465.69 g/mol |
| Exact Mass | 465.31 |
| IUPAC Name | (1S,8S,15S)-22-methyl-1,8,15-tripropylhexacyclo[13.6.1.02,7.08,22.09,14.016,21]docosa-2(7),3,5,9(14),10,12,16(21),17,19-nonaene-4,11,18-triamine |
| SMILES | CCC[C@]12c3ccc(N)cc3[C@]3(CCC)c4ccc(N)cc4[C@](CCC)(c4ccc(N)cc41)C23C |
| InChI | InChI=1S/C32H39N3/c1-5-14-30-23-11-8-21(34)18-27(23)32(16-7-3)25-13-10-22(35)19-28(25)31(15-6-2,29(30,32)4)24-12-9-20(33)17-26(24)30/h8-13,17-19H,5-7,14-16,33-35H2,1-4H3/t29?,30-,31-,32-/m0/s1 |
| InChIKey | UFVMRJFFHPAMRG-PTMYVKAOSA-N |
| XLogP | 7.04 |
| TPSA | 78.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.69 |
| LogP ≤ 5 | 7.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|