About 3-amino-4-propyl-1H-1,2,4-triazole-5-thione
3-amino-4-propyl-1H-1,2,4-triazole-5-thione (PubChem CID 13285615) has the molecular formula C5H10N4S
and a molecular weight of 158.23 g/mol. Its IUPAC name is 3-amino-4-propyl-1H-1,2,4-triazole-5-thione.
Molecular Properties
| Compound Name | 3-amino-4-propyl-1H-1,2,4-triazole-5-thione |
| PubChem CID | 13285615 |
| Molecular Formula | C5H10N4S |
| Molecular Weight | 158.23 g/mol |
| Exact Mass | 158.06 |
| IUPAC Name | 3-amino-4-propyl-1H-1,2,4-triazole-5-thione |
| SMILES | CCCn1c(N)n[nH]c1=S |
| InChI | InChI=1S/C5H10N4S/c1-2-3-9-4(6)7-8-5(9)10/h2-3H2,1H3,(H2,6,7)(H,8,10) |
| InChIKey | PINBTJKUOHXFSH-UHFFFAOYSA-N |
| XLogP | 0.93 |
| TPSA | 59.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 158.23 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 3-amino-4-propyl-1H-1,2,4-triazole-5-thione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-amino-4-propyl-1H-1,2,4-triazole-5-thione?
The IUPAC name of 3-amino-4-propyl-1H-1,2,4-triazole-5-thione (CID 13285615) is 3-amino-4-propyl-1H-1,2,4-triazole-5-thione.
What is the SMILES notation for 3-amino-4-propyl-1H-1,2,4-triazole-5-thione?
The canonical SMILES for 3-amino-4-propyl-1H-1,2,4-triazole-5-thione is CCCn1c(N)n[nH]c1=S.
What is the InChIKey of 3-amino-4-propyl-1H-1,2,4-triazole-5-thione?
The InChIKey is PINBTJKUOHXFSH-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H10N4S/c1-2-3-9-4(6)7-8-5(9)10/h2-3H2,1H3,(H2,6,7)(H,8,10).
What are the key properties of 3-amino-4-propyl-1H-1,2,4-triazole-5-thione?
3-amino-4-propyl-1H-1,2,4-triazole-5-thione has a molecular weight of 158.23 g/mol, XLogP of 0.93, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-amino-4-propyl-1H-1,2,4-triazole-5-thione is sourced from PubChem (CID 13285615), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).