About 3-(benzenesulfonyl)-5-(methoxymethyl)-2-(trichloromethyl)-1,3-oxazolidine
3-(benzenesulfonyl)-5-(methoxymethyl)-2-(trichloromethyl)-1,3-oxazolidine (PubChem CID 13285701) has the molecular formula C12H14Cl3NO4S
and a molecular weight of 374.67 g/mol. Its IUPAC name is 3-(benzenesulfonyl)-5-(methoxymethyl)-2-(trichloromethyl)-1,3-oxazolidine.
Molecular Properties
| Compound Name | 3-(benzenesulfonyl)-5-(methoxymethyl)-2-(trichloromethyl)-1,3-oxazolidine |
| PubChem CID | 13285701 |
| Molecular Formula | C12H14Cl3NO4S |
| Molecular Weight | 374.67 g/mol |
| Exact Mass | 372.97 |
| IUPAC Name | 3-(benzenesulfonyl)-5-(methoxymethyl)-2-(trichloromethyl)-1,3-oxazolidine |
| SMILES | COCC1CN(S(=O)(=O)c2ccccc2)C(C(Cl)(Cl)Cl)O1 |
| InChI | InChI=1S/C12H14Cl3NO4S/c1-19-8-9-7-16(11(20-9)12(13,14)15)21(17,18)10-5-3-2-4-6-10/h2-6,9,11H,7-8H2,1H3 |
| InChIKey | ZTPMSFFDPJPJJB-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 374.67 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 3-(benzenesulfonyl)-5-(methoxymethyl)-2-(trichloromethyl)-1,3-oxazolidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(benzenesulfonyl)-5-(methoxymethyl)-2-(trichloromethyl)-1,3-oxazolidine?
The IUPAC name of 3-(benzenesulfonyl)-5-(methoxymethyl)-2-(trichloromethyl)-1,3-oxazolidine (CID 13285701) is 3-(benzenesulfonyl)-5-(methoxymethyl)-2-(trichloromethyl)-1,3-oxazolidine.
What is the SMILES notation for 3-(benzenesulfonyl)-5-(methoxymethyl)-2-(trichloromethyl)-1,3-oxazolidine?
The canonical SMILES for 3-(benzenesulfonyl)-5-(methoxymethyl)-2-(trichloromethyl)-1,3-oxazolidine is COCC1CN(S(=O)(=O)c2ccccc2)C(C(Cl)(Cl)Cl)O1.
What is the InChIKey of 3-(benzenesulfonyl)-5-(methoxymethyl)-2-(trichloromethyl)-1,3-oxazolidine?
The InChIKey is ZTPMSFFDPJPJJB-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H14Cl3NO4S/c1-19-8-9-7-16(11(20-9)12(13,14)15)21(17,18)10-5-3-2-4-6-10/h2-6,9,11H,7-8H2,1H3.
What are the key properties of 3-(benzenesulfonyl)-5-(methoxymethyl)-2-(trichloromethyl)-1,3-oxazolidine?
3-(benzenesulfonyl)-5-(methoxymethyl)-2-(trichloromethyl)-1,3-oxazolidine has a molecular weight of 374.67 g/mol, XLogP of 2.42, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(benzenesulfonyl)-5-(methoxymethyl)-2-(trichloromethyl)-1,3-oxazolidine is sourced from PubChem (CID 13285701), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).