C15H12BrNO4 — CID 1328583
(3R)-5-bromo-3-hydroxy-3-[2-(5-methylfuran-2-yl)-2-oxoethyl]-1H-indol-2-one (PubChem CID 1328583) has the molecular formula C15H12BrNO4 and a molecular weight of 350.17 g/mol. Its IUPAC name is (3R)-5-bromo-3-hydroxy-3-[2-(5-methylfuran-2-yl)-2-oxoethyl]-1H-indol-2-one.
| Compound Name | (3R)-5-bromo-3-hydroxy-3-[2-(5-methylfuran-2-yl)-2-oxoethyl]-1H-indol-2-one |
|---|---|
| PubChem CID | 1328583 |
| Molecular Formula | C15H12BrNO4 |
| Molecular Weight | 350.17 g/mol |
| Exact Mass | 348.99 |
| IUPAC Name | (3R)-5-bromo-3-hydroxy-3-[2-(5-methylfuran-2-yl)-2-oxoethyl]-1H-indol-2-one |
| SMILES | Cc1ccc(C(=O)C[C@]2(O)C(=O)Nc3ccc(Br)cc32)o1 |
| InChI | InChI=1S/C15H12BrNO4/c1-8-2-5-13(21-8)12(18)7-15(20)10-6-9(16)3-4-11(10)17-14(15)19/h2-6,20H,7H2,1H3,(H,17,19)/t15-/m1/s1 |
| InChIKey | ZXVSZEBWYFWCND-OAHLLOKOSA-N |
| XLogP | 2.76 |
| TPSA | 79.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.17 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |